Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디에틸숙시노숙시네이트
디에틸숙시노숙시네이트 · DESS · DIETHYL SUCCINYLSUCCINATE · ETHYL SUCCINYL SUCCINATE · Diethyl succinosuccinate · DIETHYL SUCCINYLO SUCCINATE · Succinylsuccinic acid diethyl ester · Diethyl 1,4-cyclohexanedione-2,5-Dicarbo
식별자 및 물리적 특성
| CAS No. | 787-07-5 |
|---|---|
| 분자식 | C12H16O6 |
| 평균 분자량 | 256.25 g/mol |
| 단동위원소 질량 | 256.09468823 g/mol |
| SMILES | CCOC(=O)C1CC(=O)C(C(=O)OCC)CC1=O |
| InChIKey | KSKWGMNRWCYVAT-UHFFFAOYSA-N |
| PubChem CID | 95310 |
| EC No. | 212-327-8 |
| DTXSID | DTXSID50883582 |
| 현지명 | 디에틸숙시노숙시네이트 |
화학 및 물리적 성질
| XLogP | 0.3 |
|---|---|
| 극성 표면적 | 86.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 337 |
| 녹는점 | 127-129 °C(lit.) |
| 끓는 점 | 375.7±42.0 °C(Predicted) |
| 밀도 | 1.233±0.06 g/cm3(Predicted) |
| 저장 조건 | Store at room temperature |
| pKa(산도 계수) | 9.12±0.40(Predicted) |
| 물리적 상태 | powder |
| 유전율 | 2.5(19℃) |
| InChI | InChI=1S/C12H16O6/c1-3-17-11(15)7-5-10(14)8(6-9(7)13)12(16)18-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | KSKWGMNRWCYVAT-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CC(=O)C(C(OCC)=O)CC1=O |
| EPA | Diethyl 2,5-dioxo-1,4-cyclohexanedicarboxylate (787-07-5) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: 1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-, diethyl ester |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
Diethyl 1,4-cyclohexanedione-2,5-dicarboxylate reacts with benzylamine to yield diethyl 2,5-bis(benzylamino-3,6-dihydroterepthalate), which on polycondensation affords poly(amine esters).