Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸4-니트로신나메이트
에틸4-니트로신나메이트 · AKOS 344 · RARECHEM AL BI 0194 · ETHYL 4-NITROCINNAMATE · ETHYL-P-NITROCINNAMATE · ETHYL 4-NITROCINNNAMATE · Ethyl 4-nitrocinnamate ,97% · 4-Nitrozimtsaeure-ethylester
식별자 및 물리적 특성
| CAS No. | 953-26-4 |
|---|---|
| 분자식 | C11H11NO4 |
| 평균 분자량 | 221.21 g/mol |
| 단동위원소 질량 | 221.06880783 g/mol |
| SMILES | CCOC(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
| InChIKey | PFBQVGXIMLXCQB-UHFFFAOYSA-N |
| PubChem CID | 95370 |
| EC No. | 213-463-0 |
| DTXSID | DTXSID8061347 |
| 현지명 | 에틸4-니트로신나메이트 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 72.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 274 |
| 녹는점 | 138-140 °C(lit.) |
| 끓는 점 | 362.26°C (rough estimate) |
| 밀도 | 0.87 g/cm3 (20℃) |
| 굴절률 | 1.5200 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 미세 결정성 분말 |
| 색상 | 밝은 노란색-베이지색에서 노란색까지 |
| 용해도 | 불용성 |
| BRN | 2052533 |
| InChI | 1S/C11H11NO4/c1-2-16-11(13)8-5-9-3-6-10(7-4-9)12(14)15/h3-8H,2H2,1H3/b8-5+ |
| InChIKey | PFBQVGXIMLXCQB-VMPITWQZSA-N |
| SMILES | CCOC(=O)\C=C\c1ccc(cc1)[N+]([O-])=O |
| NIST | Ethyl p-nitro cinnamate(953-26-4) |
| EPA | 2-Propenoic acid, 3-(4-nitrophenyl)-, ethyl ester (953-26-4) |
화학적 성질
light yellow-beige to yellow fine cryst. powde
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | 2-Propenoic acid, 3-(4-nitrophenyl)-, ethyl ester: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | GE0353332 |
| 관세 코드 | 29163900 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Ethyl 4-nitrocinnamate was used to study the kinetics of reduction of ethyl t-cinnamate and its substituted derivatives by samarium diiodide in the presence of hexamethylphosphoramide and t-butanol.