Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디클로로프로피온산메틸에스테르
디클로로프로피온산메틸에스테르 · 메틸 2,3-다이클로로프로피온산 · 2,3-dichloropropionate · Methyl 2,3-dichloropropanoate · METHYL-A,B-DICHLOROPROPIONATE · METHYL 2,3-DICHLOROPROPIONATE · Methyl2,3-Dichloropropionate>Methyl 2,3-dichloropropionate,98% · METHYL ALPHA,BETA-DICHLOROPROPIONATE
식별자 및 물리적 특성
| CAS No. | 3674-09-7 |
|---|---|
| 분자식 | C4H6Cl2O2 |
| 평균 분자량 | 156.99 g/mol |
| 단동위원소 질량 | 155.97448479 g/mol |
| SMILES | COC(=O)C(Cl)CCl |
| InChIKey | OFHMODDLBXETIK-UHFFFAOYSA-N |
| PubChem CID | 95429 |
| EC No. | 222-940-2 |
| DTXSID | DTXSID00884004 |
| 현지명 | 디클로로프로피온산메틸에스테르 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 84.1 |
| 끓는 점 | 52-55 °C/2 mmHg (lit.) |
| 밀도 | 1.325 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.453(lit.) |
| 인화점 | 145 °F |
| 저장 조건 | Store below +30°C. |
| 용해도 | 에테르, 아세톤, 에탄올에 용해됩니다. |
| 물리적 상태 | liquid |
| 색상 | 무색 내지 거의 무색 |
| BRN | 1701891 |
| InChI | InChI=1S/C4H6Cl2O2/c1-8-4(7)3(6)2-5/h3H,2H2,1H3 |
| InChIKey | OFHMODDLBXETIK-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(Cl)CCl |
| NIST | Propanoic acid, 2,3-dichloro-, methyl ester(3674-09-7) |
| EPA | Propanoic acid, 2,3-dichloro-, methyl ester (3674-09-7) |
화학적 성질
clear colorless to slightly yellow liquid
안전 및 규제
| GHS 분류 | DangerH301 (43.8%): Toxic if swallowed [Danger Acute toxicity, oral]P203, P260, P261, P264, P264+P265, P270, P271, P280, P301+P316, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 16 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 19-06-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/24508Propanoic acid, 2,3-dichloro-, methyl ester: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 3 (43.8%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 1993 |
| 관세 코드 | 29159000 |
| 위험 문구(R) | 36/37/38-10 |
| 위험 표시 | Xi |
| 안전 문구(S) | 23-24/25-37/39-26-16 |
| 포장분류 | III |
| 위험 등급 | 8 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Methyl 2,3-dichloropropionate can be used to produce 2-chloro-acrylic acid methyl ester at Heating. It is used as pharmaceutical intermediate.