Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 95623생성일: 2026년 10월 27일
2-Propanol, 1,1'-[[2-[(2-hydroxyethyl)(2-hydroxypropyl)amino]ethyl]imino]bis-
1,1'-(2-(N-2-hydroxyethyl-2-hydroxypropylamino)ethylimino)dipropan-2-ol · 1,1'-[[2-[(2-Hydroxyethyl)(2-hydroxypropyl)amino]ethyl]imino]bis(2-propanol)
https://huagongshe.com/ko/chemical/95623
식별자 및 물리적 특성
| CAS No. | 139-90-2 |
|---|
| 분자식 | C13H30N2O4 |
|---|
| 평균 분자량 | 278.39 g/mol |
|---|
| SMILES | CC(O)CN(CCO)CCN(CC(C)O)CC(C)O |
|---|
| InChIKey | VUTCGUXQNADIRX-UHFFFAOYSA-N |
|---|
| PubChem CID | 95623 |
|---|
| EC No. | 205-382-4 |
|---|
| DTXSID | DTXSID60275934 |
|---|
화학 및 물리적 성질
| XLogP | -1.1 |
|---|
| 극성 표면적 | 87.4 |
|---|
| 수소 결합 공여자 수 | 4 |
|---|
| 수소 결합 수용자 수 | 6 |
|---|
| 회전 가능 결합 수 | 11 |
|---|
| 무거운 원자 수 | 19 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 209 |
|---|
| 녹는점 | 280 °C (decomp)(Solvent: Acetonitrile) |
|---|
| 끓는 점 | 358.556±9.00 °C(Press: 760.00 Torr)(predicted) |
|---|
| 밀도 | 1.119±0.06 g/cm3(Temp: 25 °CPress: 760 Torr)(predicted) |
|---|
| pKa(산도 계수) | 14.530±0.20(predicted) |
|---|
| EPA | 2-Propanol, 1,1'-[[2-[(2-hydroxyethyl)(2-hydroxypropyl)amino]ethyl]imino]bis- (139-90-2) |
|---|
안전 및 규제
| GHS 분류 | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)Aggregated GHS information provided per 20 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| 규제 정보 | Chemical: 2-Propanol, 1,1'-[[2-[(2-hydroxyethyl)(2-hydroxypropyl)amino]ethyl]imino]bis- |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
| TSCA 등재 상태 | TSCA listed |
|---|
![2-Propanol, 1,1'-[[2-[(2-hydroxyethyl)(2-hydroxypropyl)amino]ethyl]imino]bis- 분자 구조식](/img/chemical/95623.png)