Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(2-히드록시-3-메톡시-페닐)에타논
1-(2-히드록시-3-메톡시-페닐)에타논 · 1-(2-hydroxy-3-Methoxyphenyl)ethan-1-one · Nsc 46634 · Resorcinol Impurity 63 · 2'-Hydroxy-3'-methoxyacetophenone · Acetophenone, 2-hydroxy-3'-methoxy- · -(2-hydroxy-3-methoxy-phenyl)ethanone · 1-(2-hydroxy-3-methoxy-phenyl)ethanone
식별자 및 물리적 특성
| CAS No. | 703-98-0 |
|---|---|
| 분자식 | C9H10O3 |
| 평균 분자량 | 166.17 g/mol |
| 단동위원소 질량 | 166.06299418 g/mol |
| SMILES | COc1cccc(C(C)=O)c1O |
| InChIKey | VZEOJJIAYZCDPI-UHFFFAOYSA-N |
| PubChem CID | 95993 |
| EC No. | 836-310-5 |
| DTXSID | DTXSID50220574 |
| 현지명 | 1-(2-히드록시-3-메톡시-페닐)에타논 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 167 |
| 녹는점 | 54 °C |
| 끓는 점 | 247.2±20.0 °C(Predicted) |
| 밀도 | 1.158±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 10.17±0.10(Predicted) |
| 색상 | 연한 노란색에서 밝은 노란색까지 |
| InChI | InChI=1S/C9H10O3/c1-6(10)7-4-3-5-8(12-2)9(7)11/h3-5,11H,1-2H3 |
| InChIKey | VZEOJJIAYZCDPI-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(OC)=C1O)C |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
2''-Hydroxy-3''-methoxyacetophenone, is an intermediate used for he synthesis of various chemical compounds. It can be used for the synthesis of 4''-Hydroxy-3-methoxyflavones with potent antipicornavirus activity.
제조 및 합성 방법
제조 방법
Preparation from 2,3-dimethoxybenzonitrile and methyl-magnesium iodide in refluxing ethyl ether (Grignard reaction) (75%).