Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
6-chloro-3-methylpyrimidine-2,4(1H,3H)-dione
6-chloro-3-methylpyrimidine-2,4(1H,3H)-dione · 3-METHYL-6-CHLOROURACIL · 6-chloro-2-hydroxy-3-MethylpyriMidin-4(3H)-one · Chloro-3-Methylura · 6-Chloro-3-Methyuracil · 3-METHYL-6-CHLOROURACI · Alogliptin Impurity 86 · 6-Chloro-3-methyluraci
식별자 및 물리적 특성
| CAS No. | 4318-56-3 |
|---|---|
| 분자식 | C5H5ClN2O2 |
| 평균 분자량 | 160.56 g/mol |
| 단동위원소 질량 | 160.00395508 g/mol |
| SMILES | Cn1c(=O)cc(Cl)[nH]c1=O |
| InChIKey | SGLXGFAZAARYJY-UHFFFAOYSA-N |
| PubChem CID | 96141 |
| ChEMBL | CHEMBL1556752 |
| ChEBI | CHEBI:189258 |
| EC No. | 610-113-2 |
| DTXSID | DTXSID00195763 |
화학 및 물리적 성질
| XLogP | 0 |
|---|---|
| 극성 표면적 | 49.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 224 |
| 녹는점 | 278-280°C (dec.) |
| 밀도 | 0,896 gr/cm |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 7.16±0.40(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 511456 |
| InChI | InChI=1S/C5H5ClN2O2/c1-8-4(9)2-3(6)7-5(8)10/h2H,1H3,(H,7,10) |
| InChIKey | SGLXGFAZAARYJY-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(Cl)=CC(=O)N1C |
화학적 성질
White solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 16-07-2020 https://echa.europa.eu/registration-dossier/-/registered-dossier/18715 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1992 |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
6-Chloro-3-methyluracil have been used in the synthesis of antibacterial agents as inhibitors of Helicobacter pylori glutamate racemase.