Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸벤질레이트
에틸벤질레이트 · ETHYL BENZILATE · Einecs 257-713-7 · Ethyl benzillate · EthylBenzilate>Trospium Impurity 13 · Ethyl benzilate, 97+% · ETHYL DIPHENYLGLYCOLATE · BENZILIC ACID ETHYL ESTER
식별자 및 물리적 특성
| CAS No. | 52182-15-7 |
|---|---|
| 분자식 | C16H16O3 |
| 평균 분자량 | 256.3 g/mol |
| 단동위원소 질량 | 256.10994437 g/mol |
| SMILES | CCOC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChIKey | AIPVNQQMYPWQSX-UHFFFAOYSA-N |
| PubChem CID | 96261 |
| EC No. | 257-713-7 |
| DTXSID | DTXSID10200211 |
| 현지명 | 에틸벤질레이트 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 270 |
| 녹는점 | 29°C |
| 끓는 점 | 192-194°C 12mm |
| 밀도 | 1,562 g/cm3 |
| 굴절률 | 1.5600 |
| 인화점 | 192-194°C/12mm |
| 저장 조건 | Store at room temperature |
| 물리적 상태 | powder to lump to clear liquid |
| pKa(산도 계수) | 11.52±0.29(Predicted) |
| 색상 | White or Colorless to Yellow |
| BRN | 991958 |
| InChI | InChI=1S/C16H16O3/c1-2-19-15(17)16(18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,18H,2H2,1H3 |
| InChIKey | AIPVNQQMYPWQSX-UHFFFAOYSA-N |
| SMILES | C(O)(C(=O)OCC)(C1C=CC=CC=1)C1C=CC=CC=1 |
화학적 성질
White or colorless crystals. M.P. 34° C. This material is practically odorless, but impafis a bread-like flavor when incorporated in a flavor composition.
안전 및 규제
| GHS 분류 | DangerH302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | REACH registered substance: Ethyl diphenylglycolate (EC: 257-713-7) |
| Hazard Classes and Categories | Acute Tox. 4 (97.5%) |
| 관세 코드 | 29181990 |
| 안전 문구(S) | 24/25 |