Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,4'-바이페닐디올,3,3',5,5'-테트라클로로-
4,4'-바이페닐디올,3,3',5,5'-테트라클로로- · 3,3',5,5'-tetrachloro-4,4'-diphenol · 3,5,3',5'-TETRACHLORO-BIPHENYL-4,4'-DIOL · 4,4'-Biphenyldiol, 3,3',5,5'-tetrachloro- · [1,1'-Biphenyl]-4,4'-diol, 3,3',5,5'-tetrachloro-
식별자 및 물리적 특성
| CAS No. | 13049-13-3 |
|---|---|
| 분자식 | C12H6Cl4O2 |
| 평균 분자량 | 324 g/mol |
| 단동위원소 질량 | 321.91219 g/mol |
| SMILES | Oc1c(Cl)cc(-c2cc(Cl)c(O)c(Cl)c2)cc1Cl |
| InChIKey | YCYDXOVJXVALHY-UHFFFAOYSA-N |
| PubChem CID | 97032 |
| ChEMBL | CHEMBL83116 |
| ChEBI | CHEBI:35434 |
| EC No. | 999-170-5 |
| DTXSID | DTXSID5022352 |
| 현지명 | 4,4'-바이페닐디올,3,3',5,5'-테트라클로로- |
화학 및 물리적 성질
| XLogP | 5.4 |
|---|---|
| 극성 표면적 | 40.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 239 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP(분배 계수) | 5.14 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 163.86 Ų [M-H]- [CCS Type: cIM (TWIMS)Drift Gas: nitrogenMethod: calibrated with in-house mix] |
| 녹는점 | 235 °C |
| 끓는 점 | 389.6±37.0 °C(Predicted) |
| 밀도 | 1.624±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 5.92±0.40(Predicted) |
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P354+P338, P317, P330, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |