Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4,6- 트리메틸 벤조일 클로라이드
2,4,6-트리메틸벤조일클로라이드 · MESITOYL CHLORIDE · 2,4,6-Trimethylbenzoyl · Mesitylcarbonylchloride · TMBC · chloride Benzoyl · 4 mino-1-Boc-piperidine · chloride Mesitylcarbonyl
식별자 및 물리적 특성
| CAS No. | 938-18-1 |
|---|---|
| 분자식 | C10H11ClO |
| 평균 분자량 | 182.64 g/mol |
| 단동위원소 질량 | 182.04984265 g/mol |
| SMILES | Cc1cc(C)c(C(=O)Cl)c(C)c1 |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| PubChem CID | 97038 |
| EC No. | 213-339-6 |
| DTXSID | DTXSID20239653 |
| 현지명 | 2,4,6- 트리메틸 벤조일 클로라이드 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 167 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 끓는 점 | 143-146 °C (60 mmHg) |
| 밀도 | 1.095 g/mL at 25 °C |
| 증기압 | 1.52Pa at 25℃ |
| 굴절률 | 1.528-1.53 |
| 인화점 | 143-146°C/60mm |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 액체 |
| 색상 | 맑은 연한 노란색 |
| 용해도 | 물과 천천히 반응합니다. |
| BRN | 776108 |
| InChI | InChI=1S/C10H11ClO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=C(C)C=C(C)C=C1C |
| LogP(분배 계수) | 2.42-3.65 at 25℃ |
| NIST | 2,4,6-Trimethylbenzoyl chloride(938-18-1) |
화학적 성질
clear light yellow liquid
안전 및 규제
| GHS 분류 | DangerH312 (11.2%): Harmful in contact with skin [Warning Acute toxicity, dermal]P260, P264, P264+P265, P273, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 178 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 26-01-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/5344 |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 1760 |
| 관세 코드 | 29163990 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 45-36/37/39-26 |
| 포장분류 | II |
| 위험 등급 | 8Skin Corr. 1B |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
개요
2,4,6-Trimethylbenzoyl chloride is an important organic reagent that can be used for the electrochemical reduction reaction to prepare 2,4,6-trimethylbenzaldehyde and tetramer (i.e. 1,2-bis(2,4,6-trimethylphenyl)ethylene-1,2-diol bis(2,4,6-trimethylbenzoate))[1].
용도
2,4,6-Trimethylbenzoyl chloride is used, in the presence of pyridine, to protect OH groups as mesitoate esters.