Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-Chloro-2-methylthiopyrimidine
4-CHLORO-2-(METHYLTHIO)PYRIMIDINE · 4-CHLORO-2-METHYLSULFANYL-PYRIMIDINE · PYRIMIDINE, 4-CHLORO-2-(METHYLTHIO)- · 4-Chloro-2-(methylthio)pyrimidine 97% · 4-Chloro-2-(Methylthio)py... · 2-methylthio-4-chloropyrimine · 6-Chloro-2-methylthiopyrimidine · 2-(Methylthio)-4-chloropyrimidine
식별자 및 물리적 특성
| CAS No. | 49844-90-8 |
|---|---|
| 분자식 | C5H5ClN2S |
| 평균 분자량 | 160.63 g/mol |
| 단동위원소 질량 | 159.98619684 g/mol |
| SMILES | CSc1nccc(Cl)n1 |
| InChIKey | DFOHHQRGDOQMKG-UHFFFAOYSA-N |
| PubChem CID | 97113 |
| EC No. | 256-500-6 |
| DTXSID | DTXSID60198114 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 51.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 91 |
| 녹는점 | −2 °C(lit.) |
| 끓는 점 | 139-140 °C36 mm Hg(lit.) |
| 밀도 | 1.381 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.6(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | -0.56±0.20(Predicted) |
| 색상 | Colorless to Red to Green |
| 용해도 | 물에 섞이거나 혼합하기 어렵지 않습니다. |
| BRN | 118042 |
| InChI | InChI=1S/C5H5ClN2S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3 |
| InChIKey | DFOHHQRGDOQMKG-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=CC(Cl)=N1 |
화학적 성질
Clear yellow to brown liquid
안전 및 규제
| GHS 분류 | DangerH314 (97.9%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (97.9%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1760 8/PG 2 |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8Skin Corr. 1B |
| F 고인화성물질 | 10-13-23 |
| 위험 참고 사항 | Corrosive/Hygroscopic |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
It finds it application as a building block used in medicinal chemistry synthesis. 4-Chloro-2-methylthiopyrimidine is used in the total synthesis of the marine alkaloid variolin B1 and 2-hydroxy-4-pyrimidinecarboxylic acid. It is also used in the synthesis of 2,4-disubstituted pyrimidines, a novel class of KDR kinase inhibitors.