Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-디클로로-3-니트로톨루엔
2,6-디클로로-3-니트로톨루엔 · NSC 102503 · 2,6-DICHLORO-3-NITROTOLUENE · 2,6-Dichloro-3-nitrotoluene>2,6-Dichloro-3-nitrotoluene,99% · 2,4-dichloro-3-methylnitrobenzene · 1,3-DICHLORO-2-METHYL-4-NITROBENZENE · 2,6-DICHLORO-3-NITROTOLUENE, 99% ** SEE · Benzene, 1,3-dichloro-2-methyl-4-nitro-
식별자 및 물리적 특성
| CAS No. | 29682-46-0 |
|---|---|
| 분자식 | C7H5Cl2NO2 |
| 평균 분자량 | 206.02 g/mol |
| 단동위원소 질량 | 204.96973376 g/mol |
| SMILES | Cc1c(Cl)ccc([N+](=O)[O-])c1Cl |
| InChIKey | WBNZUUIFTPNYRN-UHFFFAOYSA-N |
| PubChem CID | 97155 |
| EC No. | 249-776-4 |
| DTXSID | DTXSID00183842 |
| 현지명 | 2,6-디클로로-3-니트로톨루엔 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 183 |
| 녹는점 | 53-56 °C (lit.) |
| 끓는 점 | 293.8±35.0 °C(Predicted) |
| 밀도 | 1.4062 (rough estimate) |
| 굴절률 | 1.6100 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Store at room temperature |
| 물리적 상태 | powder to crystal |
| 색상 | Light orange to Yellow to Green |
| 용해도 | 물에 불용성. |
| BRN | 2259855 |
| InChI | 1S/C7H5Cl2NO2/c1-4-5(8)2-3-6(7(4)9)10(11)12/h2-3H,1H3 |
| InChIKey | WBNZUUIFTPNYRN-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc(c1Cl)[N+]([O-])=O |
화학적 성질
light yellow to light green solid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29049095 |
| 위험 문구(R) | 36/37/38-20/21/22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 37/39-26 |
| 위험 등급 | 6.1 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,6-Dichloro-3-nitrotoluene, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.