Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,3,5-트리플루오로벤젠
1,3,5-트리플루오로벤젠 · 1,3,5-Trifluorobenze · 1,3,5-TrifL · Trifluorobenzene3 · sym-Trifluorobenzene · 1,3,5-Trifluorbenzol · 1,3,5-TRIFLUOROBENZENE · 1,3,5-TRIFLUOTOBENZENE
식별자 및 물리적 특성
| CAS No. | 372-38-3 |
|---|---|
| 분자식 | C6H3F3 |
| 평균 분자량 | 132.08 g/mol |
| 단동위원소 질량 | 132.01868476 g/mol |
| SMILES | Fc1cc(F)cc(F)c1 |
| InChIKey | JXUKFFRPLNTYIV-UHFFFAOYSA-N |
| PubChem CID | 9745 |
| EC No. | 206-751-2 |
| DTXSID | DTXSID90190686 |
| 현지명 | 1,3,5-트리플루오로벤젠 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 63.3 |
| 물질 분류 | Other Classes -> Halogenated Monoaromatics |
| SpringerMaterials Properties | Schoenflies notation |
| 증기압 | 104.0 [mmHg] |
| Physical Description | Colorless liquid[MSDSonline] |
| 녹는점 | -5.5 °C (lit.) |
| 끓는 점 | 75-76 °C (lit.) |
| 밀도 | 1.277 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.414(lit.) |
| 인화점 | 19 °F |
| 저장 조건 | Flammables area |
| 물리적 상태 | 투명한 액체 |
| 비중 | 1.277 |
| 색상 | 무색 내지 거의 무색 |
| 용해도 | 물에 불용성. |
| BRN | 1906457 |
| InChI | InChI=1S/C6H3F3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | JXUKFFRPLNTYIV-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1 |
| NIST | 1,3,5-Trifluorobenzene(372-38-3) |
화학적 성질
CLEAR COLOURLESS LIQUID
안전 및 규제
| GHS 분류 | DangerH225 (97.9%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | An irritant[MSDSonline] |
| Hazard Classes and Categories | Flam. Liq. 2 (97.9%) |
| 수질 위해 등급(WGK) | 2 |
| 운송 번호(UN) | UN 1993 3/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 11-36/37/38 |
| 위험 표시 | F,Xi |
| 안전 문구(S) | 16-26-36-7-33-29-7/9 |
| 포장분류 | II |
| 위험 등급 | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Flammable |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
1,3,5-Trifluorobenzene was used in the synthesis of (-)-epicatechin and its 3-O-gallate. It is also used as an intermediate in organic chemical synthesis.
일반 설명
Rotational Raman spectra of 1,3,5-trifluorobenzene has been studied under high resolution using a single mode argon laser as the exciting source. Proton and fluorine magnetic resonance spectra of 1,3,5-trifluorobenzene in a nematic liquid crystal has been analyzed.