Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디시클로헥실틴디브로마이드
디시클로헥실틴디브로마이드 · Dicyclohexyltin dibromide · dibromo(dicyclohexyl)stannane · Stannane, dibromodicyclohexyl-
식별자 및 물리적 특성
| CAS No. | 2954-94-1 |
|---|---|
| 분자식 | C12H22Br2Sn |
| 평균 분자량 | 444.82 g/mol |
| 단동위원소 질량 | 443.91103 g/mol |
| SMILES | [Br][Sn]([Br])([CH]1CCCCC1)[CH]1CCCCC1 |
| InChIKey | RHFTTZVNBAHQBF-UHFFFAOYSA-L |
| PubChem CID | 97477 |
| EC No. | 677-892-9 |
| DTXSID | DTXSID40183725 |
| 현지명 | 디시클로헥실틴디브로마이드 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 174 |
| 녹는점 | 58°C |
| 끓는 점 | 150°C/0.3mm |
| 인화점 | 150°C/0.3mm |
| 물리적 상태 | 수정 같은 |
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 운송 번호(UN) | UN3146 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
용도
용도
Dicyclohexyltin dibromide is an important chemical compound used in Pharmacology for inhibition of pancreatic cancer cell lines by organotin polyesters.