Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-니트로안트라닐라미드
5-니트로안트라닐라미드 · NSC 142033 · 5-NitroanthranilaMide · 2-CarbaMoyl-4-nitroaniline · Benzamide, 2-amino-5-nitro-
식별자 및 물리적 특성
| CAS No. | 16313-65-8 |
|---|---|
| 분자식 | C7H7N3O3 |
| 평균 분자량 | 181.15 g/mol |
| 단동위원소 질량 | 181.04874108 g/mol |
| SMILES | NC(=O)c1cc([N+](=O)[O-])ccc1N |
| InChIKey | SOBQOVZAFJDEJI-UHFFFAOYSA-N |
| PubChem CID | 97665 |
| EC No. | 605-314-7 |
| DTXSID | DTXSID00167521 |
| 현지명 | 5-니트로안트라닐라미드 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 115 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 226 |
| 녹는점 | 236.4-237.0 °C |
| 끓는 점 | 358.8±22.0 °C(Predicted) |
| 밀도 | 1.481±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 에 용해됨DMSO |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 14.63±0.50(Predicted) |
| 색상 | 노란색 |
화학적 성질
Yellow Solid
안전 및 규제
| GHS 분류 | WarningH317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin]P261, P264+P265, P272, P280, P302+P352, P305+P351+P338, P321, P333+P317, P337+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Sens. 1 (100%) |
| 관세 코드 | 2924297099 |
용도
용도
Intermediate in the preparation of nitro substituted quinazolones.