3-(Benzyloxy)-1,2-propanediol
3-(benzyloxy)propane-1,2-diol · NSC 74241 · 1-Benzylglycerol · 1-o-benzylglycerol · 1-benzylglycinether · oxy)propane-1,2-dioL · Glycerol 1-benzyl ether · 3-benzyloxy-2-propanediol
식별자 및 물리적 특성
| CAS No. | 4799-67-1 |
|---|---|
| 분자식 | C10H14O3 |
| 평균 분자량 | 182.22 g/mol |
| SMILES | OCC(O)COCc1ccccc1 |
| InChIKey | LWCIBYRXSHRIAP-UHFFFAOYSA-N |
| PubChem CID | 98072 |
| ChEMBL | CHEMBL452389 |
화학 및 물리적 성질
| XLogP | 0.3 |
|---|---|
| 극성 표면적 | 49.7 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 121 |
| 녹는점 | 62.7-63.4 °C |
| 끓는 점 | 140-145°C |
| 밀도 | 1.140 g/mL at 20 °C(lit.) |
| 굴절률 | n20/D 1.533 |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 13.65±0.20(Predicted) |
| 색상 | 회백색 |
| BRN | 3199937 |
| 안정성 | 안정적인. 흡습성. 타기 쉬운. 강한 산화제와 호환되지 않습니다. |
| InChI | InChI=1S/C10H14O3/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | LWCIBYRXSHRIAP-UHFFFAOYSA-N |
| SMILES | C(O)C(O)COCC1=CC=CC=C1 |
화학적 성질
White Semi Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | TY3180000 |
| 관세 코드 | 2909498090 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 기존화학 물질 | KE-10791 |
| F 고인화성물질 | 3-9 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
(±)-3-Benzyloxy-1,2-propanediol was used in capillary electrophoretic enantioseparation of vicinol diols using different β-cyclodextrin derivatives and borate. It was used in the synthesis and immobilization of 2,3-di-O-phytanyl-sn-glycerol-1-tetraethylene glycol-(3-trichloropropyl-silane) ether lipid (DPTTC) and 2,3-di-O-phytanyl-sn-glycerol-1-tetraethylene glycol-(3-chloro-dimethylpropyl-silane) ether lipid(DPTDC).
일반 설명
(±)-3-Benzyloxy-1,2-propanediol undergoes enantioseparation by ligand exchange micellar electrokinetic chromatography using borate anion as a central ion.