Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl Benzoin
qcu3 · nissocurembo · methylbenzoin · Methyl benzoin · O-Methylbenzoin · Benzoinemethylether · Benzoin methyl ester · Methyl benzoin ether
식별자 및 물리적 특성
| CAS No. | 3524-62-7 |
|---|---|
| 분자식 | C15H14O2 |
| 평균 분자량 | 226.27 g/mol |
| 단동위원소 질량 | 226.09937969 g/mol |
| SMILES | COC(C(=O)c1ccccc1)c1ccccc1 |
| InChIKey | BQZJOQXSCSZQPS-UHFFFAOYSA-N |
| PubChem CID | 98097 |
| EC No. | 222-538-7 |
| DTXSID | DTXSID60871031 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 237 |
| LogP(분배 계수) | 1.38 |
| 녹는점 | 47.5-48.5 °C (lit.) |
| 끓는 점 | 188-189 °C (15 mmHg) |
| 밀도 | 1.128 |
| 굴절률 | 1.6530 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 메탄올에 용해됩니다. |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 거의 흰색 |
| Merck | 14,1093 |
| BRN | 2052112 |
| InChI | 1S/C15H14O2/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,15H,1H3 |
| InChIKey | BQZJOQXSCSZQPS-UHFFFAOYSA-N |
| SMILES | COC(C(=O)c1ccccc1)c2ccccc2 |
| EPA | Ethanone, 2-methoxy-1,2-diphenyl- (3524-62-7) |
화학적 성질
white to pale green powder
안전 및 규제
| GHS 분류 | DangerH301 (97.9%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (97.9%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | AM9350000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 독성 | LD50 oral in mouse: 300mg/kg |
| 관세 코드 | 29145000 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 22-24/25 |
| 위험 등급 | 6.1Acute Tox. 3 Oral |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
Benzoin methyl ether is used in UV curing inks, wood coatings, paper coatings, optical fiber, PCB, screen printing , paper varnish and other surface coatings. It is used for anticratering in powder coatings.