Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(1)-4-Fluorophenylglycine
2-amino-2-(4-fluorophenyl)acetic acid · 4-FLUORO-DL-ALPHA-PHENYLGLYCINE · DL-4-Fluorine · DL-PHg(4-F)-OH · h-dl-phg(4-f)-oh · RARECHEM AK ML 0519 · 4-FLUOROPHENYLGLYCINE · DL-4-Flurophenylglycine
식별자 및 물리적 특성
| CAS No. | 7292-73-1 |
|---|---|
| 분자식 | C8H8FNO2 |
| 평균 분자량 | 169.15 g/mol |
| 단동위원소 질량 | 169.05390666 g/mol |
| SMILES | NC(C(=O)O)c1ccc(F)cc1 |
| InChIKey | JKFYKCYQEWQPTM-UHFFFAOYSA-N |
| PubChem CID | 98313 |
| EC No. | 230-724-4 |
| DTXSID | DTXSID801373109 |
화학 및 물리적 성질
| XLogP | -1.6 |
|---|---|
| 극성 표면적 | 63.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 166 |
| 녹는점 | ≥300 °C(lit.) |
| 끓는 점 | 289.9±30.0 °C(Predicted) |
| 밀도 | 1.347±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| pKa(산도 계수) | 1.90±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 옅은 노랑 |
| BRN | 2804849 |
| InChI | InChI=1S/C8H8FNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12) |
| InChIKey | JKFYKCYQEWQPTM-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(F)=CC=1)(N)C(=O)O |
화학적 성질
Pale yellow powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposureRespiratory tract irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%)Eye Irrit. 2A (100%)STOT SE 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29224999 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25 |
| 위험 등급 | IRRITANT |
용도
용도
L-4-Fluorophenylglycine (L-4FPG), an inhibitor of the neutral amino acid transporter ASCT1/2, has been shown to regulate extracellular D-serine levels.