Flonicamid
Aria · Flonicamid [iso] · flonicamid、flunicotamid · flonicamid 96% 158062-67-0 · N-(cyanoMethyl)-4-(trifluoroMethyl)nicotinaMide · N-(cyanomethyl)-4-(trifluoromethyl)pyridine-3-carboxamide · 3-Pyridinecarboxamide, N-(cyanomethyl)-4-(trifluoromethyl)- · F 1785
식별자 및 물리적 특성
| CAS No. | 158062-67-0 |
|---|---|
| 분자식 | C9H6F3N3O |
| 평균 분자량 | 229.161 g/mol |
| 단동위원소 질량 | 229.04629647 g/mol |
| SMILES | N#CCNC(=O)c1cnccc1C(F)(F)F |
| InChIKey | RLQJEEJISHYWON-UHFFFAOYSA-N |
| PubChem CID | 9834513 |
| ChEMBL | CHEMBL1882892 |
| ChEBI | CHEBI:39291 |
| EC No. | 605-127-0 |
| DTXSID | DTXSID8034611 |
화학 및 물리적 성질
| 녹는점 | 157.5° |
|---|---|
| 끓는 점 | 406.6±45.0 °C(Predicted) |
| 밀도 | 1.377±0.06 g/cm3(Predicted) |
| 저장 조건 | -20°C Freezer |
| 용해도 | DMSO(약간), 메탄올(약간), 에탄올(약간, 가열)에 용해됨 |
| pKa(산도 계수) | 10.99±0.46(Predicted) |
| 물리적 상태 | Solid |
| 색상 | 라이트 베이지부터 베이지까지 |
| 헨리 상수 | 2.4×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| 주요 응용 | 농업환경 |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| InChIKey | RLQJEEJISHYWON-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C(F)(F)F)=C1C(NCC#N)=O |
| LogP(분배 계수) | 0.840 (est) |
| EPA | Flonicamid (158062-67-0) |
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| 독성 | LD50 in male, female rats (mg/kg): 884, 1768 orallyin rats (mg/kg): >5000 dermallyin rats (mg/m3): >4900 by inhalationLC50 in carp, rainbow trout (mg/l): >100, >91.9 (Morita) |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 158062-67-0(Hazardous Substances Data) |
용도
개요
Flonicamid is a pyridinecarboxamide insecticide. It inhibits the brown planthopper (N. lugens) inward-rectifying potassium channel Kir1 (IC50 = 0.64 μM). Flonicamid (100 μg/ml) inhibits aphid (M. persicae) salivation and sap ingestion during feeding on Japanese radish leaves. It induces toxicity in the aphid species A. gossypii, R. padi, S. graminum, and L. erysimi (LC50s = 0.64, 0.74, 0.78, and 2.01 μg/ml, respectively) and rats (LD50 = ≥844 mg/kg). Formulations containing flonicamid have been used for the control of pest insects in agriculture.
용도
Flonicamid is an novel insecticide with rapid inhibitory effect against aphid feeding.