Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(Bromoacetyl)benzonitrile
2-Bromo-4'-cyanoacetophenone · 4-CYANOPHENACYL BROMIDE · NSC 157569 · 4-CyanophenacyL · BUTTPARK 41\03-55 · GSK-3 Inhibitor 5 · cyanophenacylbromide · 4-CYANOPHECYL BROMIDE
식별자 및 물리적 특성
| CAS No. | 20099-89-2 |
|---|---|
| 분자식 | C9H6BrNO |
| 평균 분자량 | 224.05 g/mol |
| 단동위원소 질량 | 222.96327591 g/mol |
| SMILES | N#Cc1ccc(C(=O)CBr)cc1 |
| InChIKey | LJANCPRIUMHGJE-UHFFFAOYSA-N |
| PubChem CID | 98654 |
| ChEMBL | CHEMBL1801622 |
| EC No. | 606-435-8 |
| DTXSID | DTXSID00173920 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 40.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 210 |
| 녹는점 | 92-96 °C(lit.) |
| 끓는 점 | 342.4±22.0 °C(Predicted) |
| 밀도 | 1.56±0.1 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 결정성 분말 |
| 색상 | 황백색에서 밝은 노란색까지 |
| BRN | 2087648 |
| InChI | InChI=1S/C9H6BrNO/c10-5-9(12)8-3-1-7(6-11)2-4-8/h1-4H,5H2 |
| InChIKey | LJANCPRIUMHGJE-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(CBr)=O)C=C1 |
화학적 성질
off-white to light yellow crystalline powder
안전 및 규제
| GHS 분류 | DangerH302 (95.8%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P321, P330, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 27-12-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/19711 |
| Hazard Classes and Categories | Acute Tox. 4 (95.8%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2928 6.1/PG 2 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Dam. 1Skin Corr. 1B |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
4-(2-Bromoacetyl)benzonitrile is useful for the irreversible inhibitory activity of Glycogen synthase kinase 3 (GSK-3). Phenylhalomethylketones can be used in the study of novel GSK-3 inhibitors.
일반 설명
2-Bromo-4′-cyanoacetophenone can be synthesized from ethylbenzene via aerobic photooxidation using aqueous HBr.