식별자 및 물리적 특성
| CAS No. | 64544-71-4 |
|---|
| 분자식 | C15H16N2O |
|---|
| 평균 분자량 | 240.3 g/mol |
|---|
| 단동위원소 질량 | 240.12626314 g/mol |
|---|
| SMILES | CCN(C(=O)Nc1ccccc1)c1ccccc1 |
|---|
| InChIKey | NCPIMZDJJZLMCF-UHFFFAOYSA-N |
|---|
| PubChem CID | 98685 |
|---|
| ChEMBL | CHEMBL1393651 |
|---|
| EC No. | 264-940-5 |
|---|
| DTXSID | DTXSID10214818 |
|---|
| 현지명 | 1-에틸-1,3-디페닐우레아 |
|---|
화학 및 물리적 성질
| XLogP | 2.1 |
|---|
| 극성 표면적 | 32.3 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 1 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 18 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 255 |
|---|
| LogP(분배 계수) | 3.1 |
|---|
| 녹는점 | 90.5-91 °C(Solv: ethanol (64-17-5)) |
|---|
| 끓는 점 | 423.3±18.0 °C(Predicted) |
|---|
| 밀도 | 1.172±0.06 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 14.50±0.70(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P317, P302+P352, P321, P330, P333+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
