Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 98721생성일: 2026년 10월 27일
4-(N-(4-클로로페닐)카르바모일)-2,6-디메틸모르폴린
4-(N-(4-클로로페닐)카르바모일)-2,6-디메틸모르폴린 · 4-(N-(4-Chlorophenyl)carbamoyl)-2,6-dimethylmorpholine · N-(4-Chlorophenyl)-2,6-dimethylmorpholine-4-carboxamide · 4-Morpholinecarboxamide, N-(4-chlorophenyl)-2,6-dimethyl-
https://huagongshe.com/ko/chemical/98721
식별자 및 물리적 특성
| CAS No. | 77280-30-9 |
|---|
| 분자식 | C13H17ClN2O2 |
|---|
| 평균 분자량 | 268.74 g/mol |
|---|
| 단동위원소 질량 | 268.0978555 g/mol |
|---|
| SMILES | CC1CN(C(=O)Nc2ccc(Cl)cc2)CC(C)O1 |
|---|
| InChIKey | GCBXVGDTMAULPU-UHFFFAOYSA-N |
|---|
| PubChem CID | 98721 |
|---|
| EC No. | 664-970-2 |
|---|
| DTXSID | DTXSID10998525 |
|---|
| 현지명 | 4-(N-(4-클로로페닐)카르바모일)-2,6-디메틸모르폴린 |
|---|
화학 및 물리적 성질
| XLogP | 2.2 |
|---|
| 극성 표면적 | 41.6 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 2 |
|---|
| 회전 가능 결합 수 | 1 |
|---|
| 무거운 원자 수 | 18 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 283 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 관세 코드 | 2934999090 |
|---|
