2-플루오로벤조산
2-플루오로벤조산 · OFBA · 2-fluorobenzoate · O-FLUOROBENZOIC ACID · 2-FLUOROBENZOHYDRAZIDE · ortho-Fluorobenzoic acid · NSC 10319 · Adjacent acid
식별자 및 물리적 특성
| CAS No. | 41406-98-8 |
|---|---|
| 분자식 | C7H5FO2 |
| 평균 분자량 | 140.11 g/mol |
| 단동위원소 질량 | 140.02735756 g/mol |
| SMILES | O=C(O)c1ccccc1F |
| InChIKey | NSTREUWFTAOOKS-UHFFFAOYSA-N |
| PubChem CID | 9935 |
| ChEMBL | CHEMBL114383 |
| ChEBI | CHEBI:19577 |
| EC No. | 207-158-1 |
| DTXSID | DTXSID1060001 |
| 현지명 | 2-플루오로벤조산 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 136 |
| 녹는점 | 122-125 °C (lit.) |
| 끓는 점 | 114 °C |
| 밀도 | 1,46 g/cm3 |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 7.2g/L |
| 물리적 상태 | 결정질 분말 또는 바늘 |
| pKa(산도 계수) | 3.27(at 25℃) |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 물에 약간 용해됩니다. |
| BRN | 971265 |
| InChI | InChI=1S/C7H5FO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | NSTREUWFTAOOKS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1F |
| NIST | Benzoic acid, 2-fluoro-(445-29-4) |
| EPA | Benzoic acid, 2-fluoro- (445-29-4) |
화학적 성질
white to light yellow crystal powder. soluble in organic solvents such as benzene, toluene, ketone and ether.The corresponding 2-fluorobenzoyl chloride can be obtained by reacting 2-fluorobenzoic acid with an acid chloride agent such as SOCl2, PCl3, etc.
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DH0250000 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 37/38-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-26-28-24/25-37/39-36 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Fluorobenzoic acid is an intermediate of the fungicide tritriazole and meclofenamic acid.
용도
2-Fluorobenzoic acid may be employed in the preparation of zaragozic acid A analogs. It is also used as an organic chemical synthesis intermediate.
제조 및 합성 방법
제조 방법
The preparation of 2-fluorobenzoic acid is based on anthranilic acid as raw material, adding anhydrous hydrogen fluoride and sodium nitrite in methoxyethyl methyl ether solvent for diazotization, refluxing for 3 hours, and post-processing to obtain the finished product.