제라닉애씨드
제라닉애씨드 · 3,7-dimethylocta-2,6-dienoic acid · 3,7-DIMETHYL-2,6-OCTADIENOIC ACID · GERANID · geranicaci · Geranic acid · decaprenoic acid · RARECHEM AL BO 0140
식별자 및 물리적 특성
| CAS No. | 459-80-3 |
|---|---|
| 분자식 | C10H16O2 |
| 평균 분자량 | 168.23 g/mol |
| 단동위원소 질량 | 168.11502975 g/mol |
| SMILES | CC(C)=CCCC(C)=CC(=O)O |
| InChIKey | ZHYZQXUYZJNEHD-UHFFFAOYSA-N |
| PubChem CID | 9989 |
| ChEMBL | CHEMBL3182124 |
| EC No. | 207-299-9 |
| DTXSID | DTXSID0047115 |
| 현지명 | 제라닉애씨드 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 208 |
| 끓는 점 | 250.00 °C. @ 760.00 mm Hg250 °C(lit.) |
| 녹는점 | 21.00 °C. @ 760.00 mm Hg185-186 °C (decomp) |
| Physical Description | Liquid |
| 밀도 | 0.97 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.484(lit.) |
| FEMA | 4121 | GERANIC ACID |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | H2O: 불용성 |
| pKa(산도 계수) | 5.17±0.33(Predicted) |
| 물리적 상태 | liquid |
| 색상 | Colorless liquid, slightly viscous, and increasing in viscosity with age or exposure to air and daylight. |
| 냄새 | 프로필렌 글리콜 중 10.00%. 건조,잡초,산성,녹색,곰팡이,발,우디 |
| 향취 유형 | 녹색 |
| 생물학적 소스 | synthetic |
| 용해도 | H2O: insolublealcohol: soluble |
| JECFA Number | 1825 |
| BRN | 1763804 |
| 화장품 원료 기능 | pH 조절제향기향수탈취제향료 |
| InChI | 1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12)/b9-7+ |
| InChIKey | ZHYZQXUYZJNEHD-VQHVLOKHSA-N |
| SMILES | C\C(C)=C\CC\C(C)=C\C(O)=O |
| LogP(분배 계수) | 3.46 |
| EPA | 2,6-Octadienoic acid, 3,7-dimethyl- (459-80-3) |
화학적 성질
Colorless viscous liquid; neat; sweet, foral green, geranium leafike, woody with a citrus orange body nuance.
안전 및 규제
| GHS 분류 | WarningH312 (100%): Harmful in contact with skin [Warning Acute toxicity, dermal]P264, P280, P302+P352, P317, P321, P332+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 311 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | RG5380000 |
| 관세 코드 | 2916199590 |
| 위험 문구(R) | 21-38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36/37 |
| 기존화학 물질 | KE-11585 |
| F 고인화성물질 | 10 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 DermalSkin Irrit. 2 |
| 저장 분류 | 10 - Combustible liquids |
용도
출처
Reported found in tea, tomato and wine
용도
Possible uses: orange, tea, mint, ripe fruit and melon notes.
일반 설명
Geranic acid is a monoterpenemainly used in flavor, fragrance, cosmetics and agro-industries. In vitro studies show that geranic acid exhibits strong inhibitory activity against Fusarium graminearum and Colletotrichum graminicola, the two main fungal pathogens of maize. It may be responsible for the potent tyrosinase inhibitory activity of lemongrass (Cymbopogon citratus).
제조 및 합성 방법
생산 방법
Geranic acidacid is produced1) from 2-Methylhepten-2-one-6 with Iodoor Bromoacetic ester and a Zinc type catalyst.2) by oxidation of Citral.