Oxalyl chloride → Carbonyl benzimidazole

HRID 1072539노트

반응식

HRID 1072539 반응식
[C:1](Cl)(=[O:5])[C:2](Cl)=O.COC1CCC(C(O)=O)CC1.NC1C=CC(C2[NH:26][C:27]3[CH:33]=[CH:32][C:31](N)=[CH:30][C:28]=3[N:29]=2)=CC=1>C(Cl)Cl.CN(C=O)C.N1C=CC=CC=1>[C:1](=[C:2]1[N:29]=[C:28]2[CH:30]=[CH:31][CH:32]=[CH:33][C:27]2=[N:26]1)=[O:5]

참가 물질

7

반응물 3

HCID 65578Oxalyl chlorideHCID 736153Rac-(1r,4r)-4-methoxycyclohexane-1-carboxylic acidHCID 178507432HCID 178507432, 화합물

생성물 1

HCID 22387228Carbonyl benzimidazole

시약·촉매·용매 3

HCID 6228Dimethylformamide촉매HCID 1049Pyridine용매HCID 6344Dichloromethane용매

반응 조건

온도
60 °C

실험 절차

Bis-4-methoxyclohexyl carbonyl benzimidazole was synthesized as follows: Oxalyl chloride, (1.07. ml, 2 M in CH2Cl2) was added to 4-methoxy-cyclohexane carboxylic acid (0.338 g, 2.14 mmole) followed by one drop DMF. The mixture was allowed to react at RT for 1.0 hour. To the above solution was added 2-(4-aminophenyl)-6-amino-benzimidazole (0.200 g, 0.89 mmole) in pyridine (2 ml). The reaction was heated to 60° C. overnight. The reaction was cooled and the precipitate filtered and washed with NaHCO3 and hexanes.

후처리

  1. customto react at RT for 1.0 hour
  2. temperatureThe reaction was cooled
  3. filtrationthe precipitate filtered
  4. washwashed with NaHCO3 and hexanes

출처 및 근거

ORD 기록
ord-cfd0421849c2497a88f7d19f0c404465
출처 데이터셋
uspto-grants-2005_06
특허 번호
US06911462B2

반응 노트

불러오는 중…