Methyl 4-bromo-3,5-dimethoxybenzoate → Methyl 4-[1-(ethoxy)ethenyl]-3,5-dimethoxybenzoate

HRID 1096987노트

반응식

HRID 1096987 반응식
[CH3:1][O:2][C:3]1[CH:4]=[C:5]([CH:10]=[C:11]([O:14][CH3:15])[C:12]=1Br)[C:6]([O:8][CH3:9])=[O:7].[F-].[K+].[CH2:18]([O:20][C:21]([Sn](CCCC)(CCCC)CCCC)=[CH2:22])[CH3:19]>C1(C)C=CC=CC=1.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[CH2:21]([O:20][C:18]([C:12]1[C:3]([O:2][CH3:1])=[CH:4][C:5]([C:6]([O:8][CH3:9])=[O:7])=[CH:10][C:11]=1[O:14][CH3:15])=[CH2:19])[CH3:22]

참가 물질

6

반응물 3

HCID 117713Methyl 4-bromo-3,5-dimethoxybenzoateHCID 522689Potassium FluorideHCID 619414Stannane, tributyl(1-ethoxyethenyl)-

생성물 1

HCID 57930895Methyl 4-[1-(ethoxy)ethenyl]-3,5-dimethoxybenzoate

시약·촉매·용매 2

HCID 178418397HCID 178418397, 화합물촉매HCID 1140Toluene용매

반응 조건

온도
110 °C

실험 절차

Methyl 3,5-dimethoxy-4-bromobenzoate (500 mg) was dissolved in toluene in a nitrogen atmosphere, and 1-ethoxyvinyltributyltin (742 μL) and tetrakis(triphenylphosphine)palladium (211 mg) were added to it, and stirred overnight at 110° C. The reaction liquid was cooled to room temperature, then aqueous potassium fluoride solution was added to it, and stirred at room temperature. The reaction liquid was filtered through Celite, the Celite was washed with ethyl acetate, and the filtrate was washed with saturated saline water. The organic layer was dried with sodium sulfate, the sodium sulfate was removed through filtration, the filtrate was concentrated under reduced pressure, and the residue was purified through silica gel column chromatography (hexane/ethyl acetate=100/0 to 85/15) to obtain the title compound.

후처리

  1. additionwere added to it
  2. customThe reaction liquid
  3. temperaturewas cooled to room temperature
  4. stirringstirred at room temperature
  5. customThe reaction liquid
  6. filtrationwas filtered through Celite
  7. washthe Celite was washed with ethyl acetate
  8. washthe filtrate was washed with saturated saline water
  9. dry with materialThe organic layer was dried with sodium sulfate
  10. customthe sodium sulfate was removed through filtration
  11. concentrationthe filtrate was concentrated under reduced pressure
  12. customthe residue was purified through silica gel column chromatography (hexane/ethyl acetate=100/0 to 85/15)

출처 및 근거

ORD 기록
ord-1c77621153e84b4ca2a4d1031262b5fe
출처 데이터셋
uspto-grants-2012_03
특허 번호
US08138197B2

반응 노트

불러오는 중…