Potassium Carbonate → 3,5-Dimethyl-6-phenanthridinamine

HRID 1097148

반응식

HRID 1097148 반응식
[C:1]([C:3]1[CH:8]=[CH:7][CH:6]=[CH:5][C:4]=1B1OC(C)(C)C(C)(C)O1)#[N:2].BrC1C=C(C)C=C(C)[C:20]=1[NH2:21].C(=O)([O-])[O-].[K+].[K+].[C:34]1([CH3:40])[CH:39]=[CH:38][CH:37]=[CH:36][CH:35]=1.CO>C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[CH3:40][C:34]1[CH:39]=[CH:38][C:37]2[C:4]3[C:3]([CH:1]([NH2:2])[N:21]([CH3:20])[C:36]=2[CH:35]=1)=[CH:8][CH:7]=[CH:6][CH:5]=3

참가 물질

6

반응물 4

HCID 11430Potassium CarbonateHCID 1705792-Bromo-4,6-dimethylanilineHCID 35702292-(2-Cyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolaneHCID 21867641Toluene methanol

생성물 1

HCID 574535493,5-Dimethyl-6-phenanthridinamine수율 82%

시약·촉매·용매 1

HCID 178418397HCID 178418397, 화합물촉매

실험 절차

Added together 2-cyanophenylboronic acid pinacol ester (13.7 g, 60 mmol), 2-bromo-4,6-dimethylaniline (10.0 g, 50 mmol), tetrakis(triphenylphosphine)palladium(0) (2.3 g, 2.0 mmol) and potassium carbonate (18.6 g, 138.21 mol) to a 125 mL of a 95/5 mixture of toluene/methanol. The solvents were degassed and the reaction mixture heated to reflux for 48 hours. After cooling, the reaction mixture was vacuum filtered and the organics evaporated and crude product was purified using silica gel column chromatography treated with triethylamine and 1:9 ethyl acetate and methylene chloride mixture as the eluants. The pure product was collected and concentrated to give 3,5-dimethyl-6-phenanthridinamine (9.1 g, 82% Yield).

후처리

  1. customThe solvents were degassed
  2. temperaturethe reaction mixture heated
  3. temperatureto reflux for 48 hours
  4. temperatureAfter cooling
  5. filtrationfiltered
  6. customthe organics evaporated
  7. customcrude product was purified
  8. additiontreated with triethylamine and 1:9 ethyl acetate and methylene chloride mixture as the eluants
  9. customThe pure product was collected
  10. concentrationconcentrated

출처 및 근거

ORD 기록
ord-329d65a5eb8c4fc3a52d51e4368c4614
출처 데이터셋
uspto-grants-2012_03
특허 번호
US08142909B2

연결된 노트

불러오는 중…