Cesium carbonate → HCID 58526509, 화합물

HRID 1190243노트

반응식

HRID 1190243 반응식
[C:1]1(B(O)O)[CH:6]=[CH:5][CH:4]=[CH:3][CH:2]=1.[Cl:10][C:11]1[CH:12]=[C:13]([C:23]2[N:28]=[C:27]([C:29]3[CH:30]=[C:31]([C:36]4[CH:41]=[CH:40][CH:39]=[CH:38][CH:37]=4)[CH:32]=[C:33]([Cl:35])[CH:34]=3)[N:26]=[C:25]([C:42]3[CH:47]=[C:46](Br)[CH:45]=[C:44](Br)[CH:43]=3)[N:24]=2)[CH:14]=[C:15]([C:17]2[CH:22]=[CH:21][CH:20]=[CH:19][CH:18]=2)[CH:16]=1.C(=O)([O-])[O-].[Cs+].[Cs+]>O1CCCC1.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[Cl:10][C:11]1[CH:12]=[C:13]([C:23]2[N:28]=[C:27]([C:29]3[CH:30]=[C:31]([C:36]4[CH:41]=[CH:40][CH:39]=[CH:38][CH:37]=4)[CH:32]=[C:33]([Cl:35])[CH:34]=3)[N:26]=[C:25]([C:42]3[CH:47]=[C:46]([C:1]4[CH:6]=[CH:5][CH:4]=[CH:3][CH:2]=4)[CH:45]=[C:44]([C:1]4[CH:6]=[CH:5][CH:4]=[CH:3][CH:2]=4)[CH:43]=3)[N:24]=2)[CH:14]=[C:15]([C:17]2[CH:22]=[CH:21][CH:20]=[CH:19][CH:18]=2)[CH:16]=1

참가 물질

6

반응물 3

HCID 10796Cesium carbonateHCID 66827Phenylboronic AcidHCID 58526512HCID 58526512, 화합물

생성물 1

HCID 58526509HCID 58526509, 화합물수율 84%

시약·촉매·용매 2

HCID 178418397HCID 178418397, 화합물촉매HCID 8028Tetrahydrofuran용매

실험 절차

In a stream of argon, phenylboronic acid (904 mg), 4,6-bis(5-chlorobiphenyl-3-yl)-2-(3,5-dibromophenyl)-1,3,5-triazine (1.70 g), cesium carbonate (2.41 g) and tetrakis(triphenylphosphine)palladium (114 mg) were suspended in tetrahydrofuran (80 mL), and the mixture was refluxed for 18 hours. The reaction mixture was left to stand at room temperature, and then low-boiling ingredients were distilled away under a reduced pressure. Methanol was added to the reaction mixture, and the solid precipitate was recovered by filtration, and purified by silica gel chromatography using a chloroform/hexane (1:2 to 1:0) mixed liquid as a developing solvent to give 1.42 g of the target 2,4-bis(5-chlorobiphenyl-3-yl)-6-[(1,1′:3′,1″)-terphenyl-5′-yl]-1,3,5-triazine as a yellowish white powder (yield: 84%).

후처리

  1. temperaturethe mixture was refluxed for 18 hours
  2. waitThe reaction mixture was left
  3. customto stand at room temperature
  4. distillationlow-boiling ingredients were distilled away under a reduced pressure
  5. additionMethanol was added to the reaction mixture
  6. filtrationthe solid precipitate was recovered by filtration
  7. custompurified by silica gel chromatography
  8. additionmixed liquid as a developing solvent

출처 및 근거

ORD 기록
ord-b07acd08840e417aacec9ce5a6a1d20c
출처 데이터셋
uspto-grants-2014_03
특허 번호
US08674091B2

반응 노트

불러오는 중…