Ethyl Acrylate → Methyl 4-nitrononanoate

HRID 1267229

반응식

HRID 1267229 반응식
[C:1]([O:5][CH2:6]C)(=[O:4])[CH:2]=[CH2:3].[N+:8]([CH2:11][CH2:12][CH2:13][CH2:14][CH2:15][CH3:16])([O-:10])=[O:9].C([O-])([O-])=O.[K+].[K+]>CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)C.[Cl-].CCOCC>[N+:8]([CH:11]([CH2:12][CH2:13][CH2:14][CH2:15][CH3:16])[CH2:3][CH2:2][C:1]([O:5][CH3:6])=[O:4])([O-:10])=[O:9]

참가 물질

6

반응물 3

HCID 8821Ethyl AcrylateHCID 11430Potassium CarbonateHCID 125891-Nitrohexane

생성물 1

HCID 10632556Methyl 4-nitrononanoate

시약·촉매·용매 2

HCID 21218Trioctylmethylammonium chloride촉매HCID 3283Diethyl Ether용매

실험 절차

Ex-29a) A suspension of ethyl acrylate, 1-nitrohexane, K2CO3, and Aliquat 336 (6 drops) is sonicated for 5 h. To the reaction is added Et2O . The reaction mixture is filtered, extracted with brine, dried over Na2SO4 (anhydrous), filtered, and concentrated under reduced pressure to give a yellow liquid. The product is purified by column chromatography to give methyl 4-nitrononanoate.

후처리

  1. customis sonicated for 5 h
  2. filtrationThe reaction mixture is filtered
  3. extractionextracted with brine
  4. dry with materialdried over Na2SO4 (anhydrous)
  5. filtrationfiltered
  6. concentrationconcentrated under reduced pressure
  7. customto give a yellow liquid
  8. customThe product is purified by column chromatography

출처 및 근거

ORD 기록
ord-2e93f07c1d1a43b6b9cf604f288b1c90
출처 데이터셋
uspto-grants-2003_04
특허 번호
US06552052B2

연결된 노트

불러오는 중…