Allylamine → N-2-Propen-1-yl-6-[4-(trifluoromethyl)phenyl]-2-pyridinamine

HRID 1269670노트

반응식

HRID 1269670 반응식
[CH2:1]([NH2:4])[CH:2]=[CH2:3].Br[C:6]1[CH:11]=[CH:10][CH:9]=[C:8]([C:12]2[CH:17]=[CH:16][C:15]([C:18]([F:21])([F:20])[F:19])=[CH:14][CH:13]=2)[N:7]=1>C(O)C.S([O-])([O-])(=O)=O.[Cu+2]>[CH2:1]([NH:4][C:6]1[CH:11]=[CH:10][CH:9]=[C:8]([C:12]2[CH:17]=[CH:16][C:15]([C:18]([F:19])([F:21])[F:20])=[CH:14][CH:13]=2)[N:7]=1)[CH:2]=[CH2:3]

참가 물질

5

반응물 2

HCID 7853AllylamineHCID 184483252-Bromo-6-(4-(trifluoromethyl)phenyl)pyridine

생성물 1

HCID 18448421N-2-Propen-1-yl-6-[4-(trifluoromethyl)phenyl]-2-pyridinamine수율 74.8%

시약·촉매·용매 2

HCID 24462Copper Sulfate촉매HCID 702Ethanol용매

반응 조건

온도
100 °C

실험 절차

A mixture of of allylamine (0.447 mL, 5.96 mmol) and 2-bromo-6-[4-(trifluoromethyl)phenyl]pyridine (0.1 g, 0.298 mmol) in ethanol (5 mL) were heated at 100° C. in a 25 mL pressure vessel. After heating overnight the reaction was cooled and copper sulfate was added and heating continued at 100° C. overnight. After this time the reaction was allowed to coole to room temperature and concentrated in vacuo. Purification by SPE (Silica, 10 g) eluting 3:1 cyclohexane:chloroform afforded the title compound as a dark yellow solid (0.062 g).

후처리

  1. temperatureAfter heating overnight the reaction
  2. temperaturewas cooled
  3. temperatureheating
  4. customto coole to room temperature
  5. concentrationconcentrated in vacuo
  6. customPurification by SPE (Silica, 10 g)
  7. washeluting 3:1 cyclohexane

출처 및 근거

ORD 기록
ord-546d2e7ec73a4f6e9519db19b5087601
출처 데이터셋
uspto-grants-2007_04
특허 번호
US07199239B2

반응 노트

불러오는 중…