Sodium Carbonate → 3-(4-methylphenyl)pyridine

HRID 1349008노트

반응식

HRID 1349008 반응식
[C:1]1([CH3:10])[CH:6]=[CH:5][C:4](B(O)O)=[CH:3][CH:2]=1.Br[C:12]1[CH:13]=[N:14][CH:15]=[CH:16][CH:17]=1.C([O-])([O-])=O.[Na+].[Na+]>C1(C)C=CC=CC=1.O.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[N:14]1[CH:15]=[CH:16][CH:17]=[C:12]([C:4]2[CH:5]=[CH:6][C:1]([CH3:10])=[CH:2][CH:3]=2)[CH:13]=1

참가 물질

7

반응물 3

HCID 10340Sodium CarbonateHCID 122863-BromopyridineHCID 79799Tolylboronic acid

생성물 1

HCID 41331893-(4-methylphenyl)pyridine수율 90%

시약·촉매·용매 3

HCID 178418397HCID 178418397, 화합물촉매HCID 962Water용매HCID 1140Toluene용매

실험 절차

To a mixture of 4-tolylboronic acid (38 g, 0.28 mol), 3-bromopyridine (44 g, 0.28 mol), Na2CO3 (200 g) in toluene (500 ml) and water (500 ml) was added Pd(PPh3)4 (16 g, 0.014 mol), and refluxed for 16 h. The reaction mixture was cooled, and the separated organic layer was washed with water and brine, and dried. The solvent was removed to give 4-(3-pyridyl)toluene (42 g, 90%).

후처리

  1. temperaturerefluxed for 16 h
  2. temperatureThe reaction mixture was cooled
  3. washthe separated organic layer was washed with water and brine
  4. customdried
  5. customThe solvent was removed

출처 및 근거

ORD 기록
ord-5aeb75ef1b9245f8bf3a77cd781d6baf
출처 데이터셋
uspto-grants-2007_05
특허 번호
US07211601B2

반응 노트

불러오는 중…