3-Methylacetophenone → 1-(3-(Bromomethyl)phenyl)ethan-1-one

HRID 1356777

반응식

HRID 1356777 반응식
[CH3:1][C:2]1[CH:3]=[C:4]([C:8](=[O:10])[CH3:9])[CH:5]=[CH:6][CH:7]=1.[Br:11]N1C(=O)CCC1=O>C(OOC(=O)C1C=CC=CC=1)(=O)C1C=CC=CC=1.C(Cl)(Cl)(Cl)Cl>[Br:11][CH2:1][C:2]1[CH:3]=[C:4]([C:8](=[O:10])[CH3:9])[CH:5]=[CH:6][CH:7]=1

참가 물질

5

반응물 2

HCID 114553-MethylacetophenoneHCID 67184N-bromobutanimide

생성물 1

HCID 154798071-(3-(Bromomethyl)phenyl)ethan-1-one수율 38.8%

시약·촉매·용매 2

HCID 7187Benzoyl Peroxide촉매HCID 5943Carbon Tetrachloride용매

실험 절차

3′-Methylacetophenone (5.00 g; 37.3 mmol), N-bromosuccinimide (6.63 g; 37.3 mmol), and benzoyl peroxide (100 mg) were added to carbon tetrachloride (70 ml), and the mixture was refluxed for 1 hour. The mixture was left to cool to room temperature, and crystals that precipitated were removed by filtration. The filtrate was evaporated under reduced pressure, and the residue was purified by silica gel column chromatography (n-hexane:ethyl acetate=20:1), to thereby yield 3.08 g of the target compound (yield: 38.8%).

후처리

  1. temperaturethe mixture was refluxed for 1 hour
  2. waitThe mixture was left
  3. customcrystals that precipitated
  4. customwere removed by filtration
  5. customThe filtrate was evaporated under reduced pressure
  6. customthe residue was purified by silica gel column chromatography (n-hexane:ethyl acetate=20:1)

출처 및 근거

ORD 기록
ord-fabc5a7317ba403681b8e1ab8e4315af
출처 데이터셋
uspto-grants-2003_07
특허 번호
US06586633B1

연결된 노트

불러오는 중…