Benzo(h)cinnolin-3(2H)-one, 5,6-dihydro- → 3-Chloro-5,6-dihydrobenzo[h]cinnoline

HRID 1400095노트

반응식

HRID 1400095 반응식
[N:1]1[NH:2][C:3](=O)[CH:4]=[C:5]2[C:10]=1[C:9]1[CH:11]=[CH:12][CH:13]=[CH:14][C:8]=1[CH2:7][CH2:6]2.O(Cl)[Cl:17].[P+3]>>[Cl:17][C:3]1[N:2]=[N:1][C:10]2[C:9]3[CH:11]=[CH:12][CH:13]=[CH:14][C:8]=3[CH2:7][CH2:6][C:5]=2[CH:4]=1

참가 물질

3

반응물 2

HCID 213230Benzo(h)cinnolin-3(2H)-one, 5,6-dihydro-HCID 178479710HCID 178479710, 화합물

생성물 1

HCID 104433233-Chloro-5,6-dihydrobenzo[h]cinnoline

실험 절차

5,6-Dihydrobenzo[h]cinnolin-3(2H)-one (4.5 g) was heated at 100° C. with phosphorus (III) Oxychloride (80 mL) for 6.5 h. The solvent was removed under vacuum and the residue was treated with ice water. The resulting solid was filtered off, washed well with water and air dried to give 3-chloro-5,6-dihydrobenzo[h]cinnoline; 1H NMR (DMSO-d6, 300 MHz) 8.32 (m, 1H), 7.36 (s, 1H), 7.32 (m, 2H), 7.19 (d, 1H), 2.91 (s, 4H) ppm; MS (ES) 217/219 (M+H).

후처리

  1. customThe solvent was removed under vacuum
  2. additionthe residue was treated with ice water
  3. filtrationThe resulting solid was filtered off
  4. washwashed well with water and air
  5. customdried

출처 및 근거

ORD 기록
ord-6d7ff7af32d7463c9fd09201078c0757
출처 데이터셋
uspto-grants-2014_12
특허 번호
US08906922B2

반응 노트

불러오는 중…