Triethylamine → HCID 77230289, 화합물

HRID 1455707노트

반응식

HRID 1455707 반응식
I[C:2]1[CH:3]=[C:4]([CH:7]=[CH:8][C:9]=1[O:10][CH3:11])[CH:5]=[O:6].C(N(CC)CC)C.[CH:19]#[C:20][CH2:21][CH2:22][CH2:23][CH3:24]>C1COCC1.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[C:19]([C:2]1[CH:3]=[C:4]([CH:7]=[CH:8][C:9]=1[O:10][CH3:11])[CH:5]=[O:6])#[C:20][CH2:21][CH2:22][CH2:23][CH3:24]

참가 물질

6

반응물 3

HCID 8471TriethylamineHCID 127321-HexyneHCID 14943763-iodo-4-methoxybenzaldehyde

생성물 1

HCID 77230289HCID 77230289, 화합물수율 95%

시약·촉매·용매 2

HCID 178418397HCID 178418397, 화합물촉매HCID 8028Tetrahydrofuran용매

실험 절차

A mixture of 3-iodo-4-methoxybenzaldehyde (5.2 g, 20 mmol), tetrakis(triphenylphosphine)palladium (0.29 g), Cul (0.38 g, 2 mmol) and triethylamine (5 ml) in THF (25 ml) is cooled to +10° C., and 1-hexyne (3.5 ml, 30.5 mmol) is then added. The cooling bath is removed, and the temperature of the reaction mixture rises slowly to +30° C. before decreasing slowly. 3 hours after the end of the addition, the crude reaction product is concentrated to dryness, and the residue obtained is purified by flash chromatography on silica (15/85 ethyl acetate/heptane). 4.1 g (yield: 95%) of the expected product are obtained.

후처리

  1. temperatureis cooled to +10° C.
  2. customThe cooling bath is removed
  3. customrises slowly to +30° C.
  4. addition3 hours after the end of the addition
  5. customthe crude reaction product
  6. concentrationis concentrated to dryness
  7. customthe residue obtained
  8. customis purified by flash chromatography on silica (15/85 ethyl acetate/heptane)

출처 및 근거

ORD 기록
ord-ce6153a227f2452ca5e9ca7e8f312dc4
출처 데이터셋
uspto-grants-2009_01
특허 번호
US07482484B2

반응 노트

불러오는 중…