Methacrylic Acid → Methyl 1-methacryloyloxyethyl carbonate

HRID 1488878

반응식

HRID 1488878 반응식
CC(C)([O-])C.[K+].[C:7]([OH:12])(=[O:11])[C:8]([CH3:10])=[CH2:9].[C:13](=[O:20])([O:16][CH:17](Cl)[CH3:18])[O:14][CH3:15]>CN(C=O)C.C1OCCOCCOCCOCCOCCOC1>[C:13](=[O:20])([O:16][CH:17]([O:11][C:7](=[O:12])[C:8]([CH3:10])=[CH2:9])[CH3:18])[O:14][CH3:15]

참가 물질

6

반응물 3

HCID 4093Methacrylic AcidHCID 135066411-Chloroethyl methyl carbonateHCID 23665647Potassium tert-butoxide

생성물 1

HCID 19063416Methyl 1-methacryloyloxyethyl carbonate수율 72%

시약·촉매·용매 2

HCID 2855718-Crown-6촉매HCID 6228Dimethylformamide용매

실험 절차

Potassium tert. butoxide (3.70 g, 0.033 mol ) was added to a solution of methacrylic acid (2.84 g, 0.033 mol) in DMF (100 ml). Methyl 1-chloroethyl carbonate (4.55 g, 0.033 mol) from Example 1u(i) above was added to the resulting suspension. 18-crown-6 (0.61 g, 2.3 mmol) was then added and the reaction mixture was left with stirring at room temperature for 3 days. The reaction mixture was filtered and the solvent was removed under reduced pressure. The residue was dissolved in chloroform (100 ml) and washed with saturated aqueous sodium hydrogen carbonate (50 ml) and water (50 ml). The organic phase was dried (MgSO4) and the solvent removed under reduced pressure. Flash chromatography gave 4.46 g (72%) of the title product.

후처리

  1. waitthe reaction mixture was left
  2. filtrationThe reaction mixture was filtered
  3. customthe solvent was removed under reduced pressure
  4. dissolutionThe residue was dissolved in chloroform (100 ml)
  5. washwashed with saturated aqueous sodium hydrogen carbonate (50 ml) and water (50 ml)
  6. dry with materialThe organic phase was dried (MgSO4)
  7. customthe solvent removed under reduced pressure

출처 및 근거

ORD 기록
ord-ad475ae23d2d4b8d828d92becbe9555b
출처 데이터셋
uspto-grants-1997_10
특허 번호
US05676925

연결된 노트

불러오는 중…