4-(3-Chloropropyl)morpholine → HCID 20303044, 화합물

HRID 1732877노트

반응식

HRID 1732877 반응식
[CH2:1]([N:3]([CH2:8][CH3:9])[C:4]([NH:6][CH3:7])=[O:5])[CH3:2].[Cl:10][CH2:11][CH2:12][CH2:13][N:14]1[CH2:19][CH2:18][O:17][CH2:16][CH2:15]1>O1CCOCC1>[ClH:10].[CH2:1]([N:3]([CH2:8][CH3:9])[C:4]([N:6]([CH3:7])[CH2:11][CH2:12][CH2:13][N:14]1[CH2:19][CH2:18][O:17][CH2:16][CH2:15]1)=[O:5])[CH3:2]

참가 물질

4

반응물 2

HCID 958344-(3-Chloropropyl)morpholineHCID 135031N,N-Diethyl-N'-methylurea

생성물 1

HCID 20303044HCID 20303044, 화합물

시약·촉매·용매 1

HCID 312751,4-Dioxane용매2회

실험 절차

13 g (0.1 mole) of N,N-diethyl-N'methyl urea are dissolved in 100 cc. of anhydrous dioxane. 3.9 g (0.1 mole) of NaNH2 are added thereto and the reaction mixture is heated one hour at reflux. After cooling, 16.4 g (0.1 mole) of N-(3-chloropropyl)morpholine dissolved in 50 cc. of anhydrous dioxane are added thereto dropwise and the reaction mixture is refluxed for 6 hours. After cooling, the precipitated NaCl is filtered off with suction, the filtrate is evaporated and the remaining residue is subjected to fractionated distillation.

후처리

  1. temperaturethe reaction mixture is heated one hour
  2. temperatureat reflux
  3. temperatureAfter cooling
  4. temperaturedropwise and the reaction mixture is refluxed for 6 hours
  5. temperatureAfter cooling
  6. filtrationthe precipitated NaCl is filtered off with suction
  7. customthe filtrate is evaporated
  8. distillationthe remaining residue is subjected to fractionated distillation

출처 및 근거

ORD 기록
ord-8bbe7d843dbb45bd82108f180c340889
출처 데이터셋
uspto-grants-1980_12
특허 번호
US04239761

반응 노트

불러오는 중…