Benzyl Bromide → HCID 89586067, 화합물

HRID 1747778노트

반응식

HRID 1747778 반응식
[Br:1][C:2]1[C:3](=[O:14])[NH:4][CH:5]=[C:6]([C:8]2[CH:13]=[CH:12][CH:11]=[CH:10][CH:9]=2)[N:7]=1.[CH2:15](Br)[C:16]1[CH:21]=[CH:20][CH:19]=[CH:18][CH:17]=1>C(=O)([O-])[O-].[Ag+2].C1(C)C=CC=CC=1>[CH2:15]([O:14][C:3]1[C:2]([Br:1])=[N:7][C:6]([C:8]2[CH:13]=[CH:12][CH:11]=[CH:10][CH:9]=2)=[CH:5][N:4]=1)[C:16]1[CH:21]=[CH:20][CH:19]=[CH:18][CH:17]=1

참가 물질

5

반응물 2

HCID 7498Benzyl BromideHCID 124535473-Bromo-5-phenylpyrazin-2(1H)-one

생성물 1

HCID 89586067HCID 89586067, 화합물

시약·촉매·용매 2

HCID 178418647HCID 178418647, 화합물촉매HCID 1140Toluene용매

실험 절차

A mixture of 3-bromo-5-phenylpyrazin-2(1H)-one (0.16 g), silver carbonate (0.18 g), benzyl bromide (0.080 mL) and toluene (6.0 mL) was heated under reflux for 3 hr. The reaction mixture was cooled to room temperature, filtered through celite, and the filtrate was concentrated under reduced pressure. The residue was purified by silica gel column chromatography (ethyl acetate/hexane) to give the title compound (0.21 g).

후처리

  1. temperaturewas heated
  2. temperatureunder reflux for 3 hr
  3. filtrationfiltered through celite
  4. concentrationthe filtrate was concentrated under reduced pressure
  5. customThe residue was purified by silica gel column chromatography (ethyl acetate/hexane)

출처 및 근거

ORD 기록
ord-f6a63cc726934a83a9866cdf2d4bfc42
출처 데이터셋
uspto-grants-2015_10
특허 번호
US09150588B2

반응 노트

불러오는 중…