Sodium Carbonate → Tert-butyl 2-acetoxy-2-(4'-(trifluoromethoxy)biphenyl-3-yl)acetate

HRID 1751772노트

반응식

HRID 1751772 반응식
[C:1]([O:4][CH:5]([C:13]1[CH:18]=[CH:17][CH:16]=[C:15](Br)[CH:14]=1)[C:6]([O:8][C:9]([CH3:12])([CH3:11])[CH3:10])=[O:7])(=[O:3])[CH3:2].C([O-])([O-])=O.[Na+].[Na+].[F:26][C:27]([F:39])([F:38])[O:28][C:29]1[CH:34]=[CH:33][C:32](B(O)O)=[CH:31][CH:30]=1>C(#N)C.O.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[C:1]([O:4][CH:5]([C:13]1[CH:14]=[C:15]([C:32]2[CH:31]=[CH:30][C:29]([O:28][C:27]([F:26])([F:38])[F:39])=[CH:34][CH:33]=2)[CH:16]=[CH:17][CH:18]=1)[C:6]([O:8][C:9]([CH3:12])([CH3:11])[CH3:10])=[O:7])(=[O:3])[CH3:2]

참가 물질

7

반응물 3

HCID 10340Sodium CarbonateHCID 27343864-(Trifluoromethoxy)phenylboronic acidHCID 71229801Tert-butyl 2-acetoxy-2-(3-bromophenyl)acetate

생성물 1

HCID 71212153Tert-butyl 2-acetoxy-2-(4'-(trifluoromethoxy)biphenyl-3-yl)acetate

시약·촉매·용매 3

HCID 178418397HCID 178418397, 화합물촉매HCID 962Water용매HCID 6342Acetonitrile용매

반응 조건

온도
130 °C

실험 절차

A mixture of compound 3 (811 mg, 2.46 mmol), Na2CO3 (650 mg, 6.13 mmol), Pd(PPh3)4 (207 mg, 0.18 mmol) and 4-trifluoromethoxy phenyl boronic acid (870 mg, 4.22 mmol) in acetonitrile (7.0 mL) and water (0.7 mL) was heated to 130° C. in the microwave for 30 minutes. The mixture was filtered through Celite® diatomaceous earth and washed with EtOAc. The filtrate was concentrated in vacuo and the resulting residue was purified by flash chromatography (80 g silica cartridge, 0-10% EtOAc/hexanes) to provide compound 4.

후처리

  1. filtrationThe mixture was filtered through Celite® diatomaceous earth
  2. washwashed with EtOAc
  3. concentrationThe filtrate was concentrated in vacuo
  4. customthe resulting residue was purified by flash chromatography (80 g silica cartridge, 0-10% EtOAc/hexanes)

출처 및 근거

ORD 기록
ord-9785a8cc8e414b6389ab089e14987704
출처 데이터셋
uspto-grants-2015_10
특허 번호
US09161924B2

반응 노트

불러오는 중…