Methanol → HCID 178437817, 화합물

HRID 1754370노트

반응식

HRID 1754370 반응식
I[C:2]1[NH:6][C:5]([CH3:7])=[N:4][C:3]=1[C:8]([F:11])([F:10])[F:9].C([O-])([O-])=O.[K+].[K+].CO.CO[CH2:22][CH2:23]OC>O.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[CH3:7][C:5]1[NH:6][C:2]([CH:22]=[CH2:23])=[C:3]([C:8]([F:11])([F:10])[F:9])[N:4]=1

참가 물질

7

반응물 4

HCID 887MethanolHCID 80711,2-DimethoxyethaneHCID 11430Potassium CarbonateHCID 178432833HCID 178432833, 화합물

생성물 1

HCID 178437817HCID 178437817, 화합물수율 72%

시약·촉매·용매 2

HCID 178418397HCID 178418397, 화합물촉매HCID 962Water용매

반응 조건

온도
80 °C

실험 절차

To a solution of 5-iodo-2-methyl-4-(trifluoromethyl)-1H-imidazole (1.98 g, 7.2 mmol) in DME (20 mL) and H2O (4 mL) was added K2CO3 (10 g, 71.9 mmol), trivinylboronic anhydride pyridine complex (1.73 g, 7.19 mmol) and Pd(PPh3)4 (830 mg, 0.719 mmol). The resulting reaction mixture was stirred at 80° C. for 3 h. MeOH (100 mL) was then added to the reaction mixture and the mixture was filtered, concentrated in vacuo, and purified by flash chromatography (SiO2, 10% MeOH/CH2Cl2) to obtain 2-methyl-4-(trifluoromethyl)-5-vinyl-1H-imidazole (911 mg, 5.17 mmol, 72% yield) as a brown syrup.

후처리

  1. customThe resulting reaction mixture
  2. filtrationthe mixture was filtered
  3. concentrationconcentrated in vacuo
  4. custompurified by flash chromatography (SiO2, 10% MeOH/CH2Cl2)

출처 및 근거

ORD 기록
ord-36d69de34f3e4b71b6c2cd86e0dba1a4
출처 데이터셋
uspto-grants-2015_10
특허 번호
US09169248B2

반응 노트

불러오는 중…