Potassium Carbonate → Telmisartan methyl ester

HRID 1783902노트

반응식

HRID 1783902 반응식
[CH3:1][N:2]1[C:6]2[CH:7]=[CH:8][CH:9]=[CH:10][C:5]=2[N:4]=[C:3]1[C:11]1[CH:22]=[C:21]([CH3:23])[C:14]2[N:15]=[C:16]([CH2:18][CH2:19][CH3:20])[NH:17][C:13]=2[CH:12]=1.[C:24]([O-])([O-])=O.[K+].[K+].Br[CH2:31][C:32]1[CH:37]=[CH:36][C:35]([C:38]2[C:39]([C:44]([OH:46])=[O:45])=[CH:40][CH:41]=[CH:42][CH:43]=2)=[CH:34][CH:33]=1>[Cl-].C[N+](CCCC)(CCCC)CCCC.C1(C)C=CC=CC=1>[CH3:20][CH2:19][CH2:18][C:16]1[N:17]([CH2:31][C:32]2[CH:37]=[CH:36][C:35]([C:38]3[C:39]([C:44]([O:46][CH3:24])=[O:45])=[CH:40][CH:41]=[CH:42][CH:43]=3)=[CH:34][CH:33]=2)[C:13]2[C:14](=[C:21]([CH3:23])[CH:22]=[C:11]([C:3]3[N:2]([CH3:1])[C:6]4[C:5](=[CH:10][CH:9]=[CH:8][CH:7]=4)[N:4]=3)[CH:12]=2)[N:15]=1

참가 물질

6

반응물 3

HCID 11430Potassium CarbonateHCID 97960434'-(Bromomethyl)-(1,1'-biphenyl)-2-carboxylic acidHCID 97964884-Methyl-6-(1-methyl-1H-benzimidazol-2-yl)-2-propyl-1H-benzimidazole

생성물 1

HCID 11497808Telmisartan methyl ester수율 72.3%

시약·촉매·용매 2

HCID 91822Tributylmethylammonium chloride촉매HCID 1140Toluene용매2회

반응 조건

온도
87.5 °C

실험 절차

1,7′-dimethyl-2′-propyl-1H,3′H-[2,5′]bibenzoimidazolyl (BIM) (4 g), Aliquat® 175 (1.36 ml), K2CO3 (8.19 g), and toluene (50 ml) were added to a 250 ml round bottom flask equipped with a magnetic stirring bar and reflux condenser. The mixture was heated to reflux (about 85-90° C.) until a clear brown organic solution was obtained. 4′bromomethyl-biphenyl-2-carboxylic acid (BMBP) methyl ester (4.5 g) in toluene (24 ml) was added to the clear brown organic solution to form a reaction mixture. The reaction mixture was stirred for about 6 hrs then cooled by ice bath and filtered forming a cooled reaction mixture. The cooled reaction mixture was then extracted twice with water (20 ml), dried over MgSO4, and evaporated forming telmisartan methyl ester (5.02 g), which is about a 69% yield.

후처리

  1. customequipped with a magnetic stirring bar
  2. temperaturereflux condenser
  3. temperatureThe mixture was heated
  4. customwas obtained
  5. customto form a reaction mixture
  6. temperaturethen cooled by ice bath
  7. filtrationfiltered
  8. customforming
  9. customa cooled reaction mixture
  10. customThe cooled reaction mixture
  11. extractionwas then extracted twice with water (20 ml)
  12. dry with materialdried over MgSO4
  13. customevaporated

출처 및 근거

ORD 기록
ord-6e348835439b42cf93ab335a3b32cf69
출처 데이터셋
uspto-grants-2009_03
특허 번호
US07501448B2

반응 노트

불러오는 중…