Methyl bicyclo[2.2.1]hept-5-ene-2-carboxylate → 4-Hydroxy-4-methylpentyl 5-norbornene-2-carboxylate

HRID 1835966노트

반응식

HRID 1835966 반응식
[CH3:1][C:2]([OH:8])([CH3:7])[CH2:3][CH2:4][CH2:5][OH:6].[CH:9]12[CH2:15][CH:12]([CH:13]=[CH:14]1)[CH2:11][CH:10]2[C:16](OC)=[O:17]>C[O-].[Na+].C1(C)C=CC=CC=1>[CH:9]12[CH2:15][CH:12]([CH:13]=[CH:14]1)[CH2:11][CH:10]2[C:16]([O:6][CH2:5][CH2:4][CH2:3][C:2]([OH:8])([CH3:7])[CH3:1])=[O:17]

참가 물질

5

반응물 2

HCID 250075Methyl bicyclo[2.2.1]hept-5-ene-2-carboxylateHCID 109862004-Methylpentane-1,4-diol

생성물 1

HCID 221790144-Hydroxy-4-methylpentyl 5-norbornene-2-carboxylate수율 93%

시약·촉매·용매 2

HCID 10942334Sodium Methoxide촉매HCID 1140Toluene용매

실험 절차

A mixture of 118 g of 4-methyl-1,4-pentanediol, 173 g of methyl 5-norbornene-2-carboxylate, 1.4 g of sodium methoxide and 400 ml of toluene was heated under reflux for 5 hours while distilling off the methanol which formed during the reaction. The reaction solution was cooled, washed with saturated sodium bicarbonate water, dried over anhydrous sodium sulfate, and concentrated in vacuum. It was purified by vacuum distillation, collecting 221 g of 4-hydroxy-4-methylpentyl 5-norbornene-2-carboxylate (yield: 93%). The physical data of this product were in good coincidence with those of Synthesis Example 1.

후처리

  1. temperaturewas heated
  2. temperatureunder reflux for 5 hours
  3. distillationwhile distilling off the methanol which
  4. customformed during the reaction
  5. temperatureThe reaction solution was cooled
  6. washwashed with saturated sodium bicarbonate water
  7. dry with materialdried over anhydrous sodium sulfate
  8. concentrationconcentrated in vacuum
  9. distillationIt was purified by vacuum distillation

출처 및 근거

ORD 기록
ord-b64690e674fb43fbb39d6b74b5a246ab
출처 데이터셋
uspto-grants-2004_08
특허 번호
US06774258B2

반응 노트

불러오는 중…