Diethyl 6-ethoxy-3-pyridylaminomethylenemalonate → Ethyl 6-ethoxy-1,4-dihydro-4-oxo-1,5-naphthyridine-3-carboxylate

HRID 1856717노트

반응식

HRID 1856717 반응식
[CH2:1]([O:3][C:4]1[CH:9]=[CH:8][C:7]([NH:10][CH:11]=[C:12]([C:18]([O:20]CC)=O)[C:13]([O:15][CH2:16][CH3:17])=[O:14])=[CH:6][N:5]=1)[CH3:2]>C1(OC2C=CC=CC=2)C=CC=CC=1>[CH2:1]([O:3][C:4]1[N:5]=[C:6]2[C:7](=[CH:8][CH:9]=1)[NH:10][CH:11]=[C:12]([C:13]([O:15][CH2:16][CH3:17])=[O:14])[C:18]2=[O:20])[CH3:2]

참가 물질

3

반응물 1

HCID 621746Diethyl 6-ethoxy-3-pyridylaminomethylenemalonate

생성물 1

HCID 604651Ethyl 6-ethoxy-1,4-dihydro-4-oxo-1,5-naphthyridine-3-carboxylate수율 58%

시약·촉매·용매 1

HCID 7583Diphenyl Ether용매

실험 절차

Diethyl (2-ethoxy-5-pyridylaminomethylene)malonate (6.04 g) was added to diphenyl ether (20 mL) preheated to 230° C. Heating was continued for 0.5 h, the reaction flask removed from the oil bath, and the mixture allowed to cool to ambient temperature. The product was triturated with 1:1 ether:hexanes, collected, rinsed with ether, and dried to give 2.98 g of ethyl 6-ethoxy-4-oxo-1,4-dihydro-1,5-naphthyridine-3-carboxylate as a tan solid.

후처리

  1. custompreheated to 230° C
  2. temperatureHeating
  3. customthe reaction flask removed from the oil bath
  4. customThe product was triturated with 1:1 ether
  5. customhexanes, collected
  6. washrinsed with ether
  7. customdried

출처 및 근거

ORD 기록
ord-f2ea189d2daa422db1dfb8f2ba5fcd93
출처 데이터셋
uspto-grants-2000_11
특허 번호
US06143760

반응 노트

불러오는 중…