Sodium Carbonate → 4'-Methoxy[1,1'-biphenyl]-4-sulfonic acid

HRID 1964798노트

반응식

HRID 1964798 반응식
[CH3:1][O:2][C:3]1[CH:8]=[CH:7][C:6](B(O)O)=[CH:5][CH:4]=1.[Na].Br[C:14]1[CH:19]=[CH:18][C:17]([S:20]([O-:23])(=[O:22])=[O:21])=[CH:16][CH:15]=1.C([O-])([O-])=O.[Na+].[Na+]>C1(C)C=CC=CC=1.O.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[CH3:1][O:2][C:3]1[CH:8]=[CH:7][C:6]([C:14]2[CH:19]=[CH:18][C:17]([S:20]([OH:23])(=[O:22])=[O:21])=[CH:16][CH:15]=2)=[CH:5][CH:4]=1

참가 물질

7

반응물 3

HCID 10340Sodium CarbonateHCID 201262(4-Methoxyphenyl)boronic acidHCID 86600836Sodium 4-bromobenzene-sulfonate

생성물 1

HCID 234334014'-Methoxy[1,1'-biphenyl]-4-sulfonic acid수율 89.6%

시약·촉매·용매 3

HCID 178418397HCID 178418397, 화합물촉매HCID 962Water용매HCID 1140Toluene용매

실험 절차

A mixture of 4-methoxyphenylboronic acid (35 g, 0.23 mol), sodium-4-bromobenzene-sulfonate (50 g, 0.19 mol) and Na2CO3 (200 g) were taken in toluene (1000 ml) and water (500 ml). To this was added Pd(PPh3)4 (11 g, 0.011 mol) and the reaction mixture was refluxed for 12 h under N2 atmosphere. The reaction mixture was cooled, filtered off the solid residue, washed with toluene and acidified with 6N HCl. The solid precipitate was filtered and dried to give 4′-methoxy[1,1′-biphenyl]-4-sulfonic acid (45 g, 88%).

후처리

  1. temperaturethe reaction mixture was refluxed for 12 h under N2 atmosphere
  2. temperatureThe reaction mixture was cooled
  3. filtrationfiltered off the solid residue
  4. washwashed with toluene
  5. filtrationThe solid precipitate was filtered
  6. customdried

출처 및 근거

ORD 기록
ord-7c27cc6854294f1c9021336fa4b8f616
출처 데이터셋
uspto-grants-2013_04
특허 번호
US08415480B2

반응 노트

불러오는 중…