Nitrobenzene → 2-oxo-3-tert-butoxycarbonylamino-5-phenyl-8-methyl-1,3,4,5-tetrahydro-2H-1,5-benzodiazepine

HRID 1979346노트

반응식

HRID 1979346 반응식
[O:1]=[C:2]1[NH:8][C:7]2[CH:9]=[C:10]([CH3:13])[CH:11]=[CH:12][C:6]=2[N:5]([CH:14]2[CH2:19][CH2:18][CH2:17][CH:16]=[CH:15]2)[CH2:4][CH:3]1[NH:20][C:21]([O:23][C:24]([CH3:27])([CH3:26])[CH3:25])=[O:22].[N+](C1C=CC=CC=1)([O-])=O>C1(C)C(C)=CC=CC=1.[C].[Pd]>[O:1]=[C:2]1[NH:8][C:7]2[CH:9]=[C:10]([CH3:13])[CH:11]=[CH:12][C:6]=2[N:5]([C:14]2[CH:19]=[CH:18][CH:17]=[CH:16][CH:15]=2)[CH2:4][CH:3]1[NH:20][C:21]([O:23][C:24]([CH3:27])([CH3:26])[CH3:25])=[O:22]

참가 물질

5

반응물 2

HCID 7416NitrobenzeneHCID 212015412-oxo-3-tert-butoxycarbonylamino-5-(2-cyclohexene-1-yl)-8-methyl-1,3,4,5-tetrahydro-2H-1,5-benzodiazepine

생성물 1

HCID 212017702-oxo-3-tert-butoxycarbonylamino-5-phenyl-8-methyl-1,3,4,5-tetrahydro-2H-1,5-benzodiazepine수율 83.5%

시약·촉매·용매 2

HCID 178418390HCID 178418390, 화합물촉매HCID 7237O-Xylene용매

실험 절차

2-Oxo-3-tert-butoxycarbonylamino-5-(2-cyclohexen-1-yl)-8-methyl-1,3,4,5-tetrahydro-2H-1,5-benzodiazepine (500 mg) was suspended in xylene (20 ml), nitrobenzene (831 mg) and 10% palladium carbon (250 mg) were added therto, and the mixture was refluxed for 2 hours. The reaction mixture was allowed to cool, filtrated, and the filtrate was concentrated under reduced pressure. Diisopropyl ether was added to the residue, crystals so precipitated were collected by filtration, to thereby obtain 413 mg of the titled compound (Yield: 83%).

후처리

  1. temperaturewas refluxed for 2 hours
  2. temperatureto cool
  3. filtrationfiltrated
  4. concentrationthe filtrate was concentrated under reduced pressure
  5. additionDiisopropyl ether was added to the residue, crystals
  6. customso precipitated
  7. filtrationwere collected by filtration

출처 및 근거

ORD 기록
ord-9ab8b04b09084eb4acce0b6b02ef6938
출처 데이터셋
uspto-grants-2001_05
특허 번호
US06239131B1

반응 노트

불러오는 중…