Morpholine → HCID 71075457, 화합물

HRID 2170721노트

반응식

HRID 2170721 반응식
[CH3:1][O:2][C:3]([C:5]1[CH:6]=[C:7]([CH:26]=[CH:27][CH:28]=1)[CH2:8][N:9]1[C:17]2[C:12](=[CH:13][C:14]([C:18]([O:20]CC=C)=[O:19])=[CH:15][CH:16]=2)[C:11]([CH3:24])=[C:10]1[CH3:25])=[O:4].N1CCOCC1>C1COCC1.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[CH3:1][O:2][C:3]([C:5]1[CH:6]=[C:7]([CH:26]=[CH:27][CH:28]=1)[CH2:8][N:9]1[C:17]2[C:12](=[CH:13][C:14]([C:18]([OH:20])=[O:19])=[CH:15][CH:16]=2)[C:11]([CH3:24])=[C:10]1[CH3:25])=[O:4]

참가 물질

5

반응물 2

HCID 8083MorpholineHCID 86674599HCID 86674599, 화합물

생성물 1

HCID 71075457HCID 71075457, 화합물

시약·촉매·용매 2

HCID 178418397HCID 178418397, 화합물촉매HCID 8028Tetrahydrofuran용매

실험 절차

The mixture of allyl 1-(3-(methoxycarbonyl)benzyl)-2,3-dimethyl-1H-indole-5-carboxylate (133 mg, 0.35 mmol) and morpholine (0.3 mL, 3.4 mmol) in THF (4 mL) was degassed and then Pd(PPh3)4 (41 mg, 0.035 mmol) was added. The mixture was stirred at room temperature for 1 h. The solvent was removed and the residue was dissolved in Methanol and acidified to pH 4. The precipitate was collected and washed with water to obtain the title compound.

후처리

  1. customwas degassed
  2. customThe solvent was removed
  3. dissolutionthe residue was dissolved in Methanol
  4. customThe precipitate was collected
  5. washwashed with water

출처 및 근거

ORD 기록
ord-783ca35ee8a24193b06e89f7523cbedf
출처 데이터셋
uspto-grants-2015_06
특허 번호
US09051265B2

반응 노트

불러오는 중…