Potassium Carbonate → HCID 57761071, 화합물

HRID 230936노트

반응식

HRID 230936 반응식
Cl[C:2]1[C:7]([CH3:8])=[C:6]([N:9]2[CH2:14][CH2:13][N:12]([C:15]3[C:20]([C:21]([F:24])([F:23])[F:22])=[CH:19][CH:18]=[CH:17][N:16]=3)[CH2:11][CH2:10]2)[N:5]=[C:4]([N:25]2[CH2:30][CH2:29][O:28][CH2:27][CH2:26]2)[N:3]=1.[Cl:31][C:32]1[CH:33]=[C:34](B(O)O)[CH:35]=[CH:36][C:37]=1[F:38].C(=O)([O-])[O-].[K+].[K+]>C1(C)C=CC=CC=1.C1C=CC([P]([Pd]([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)([P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)[P](C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC=CC=2)=CC=1>[Cl:31][C:32]1[CH:33]=[C:34]([C:2]2[C:7]([CH3:8])=[C:6]([N:9]3[CH2:14][CH2:13][N:12]([C:15]4[C:20]([C:21]([F:23])([F:22])[F:24])=[CH:19][CH:18]=[CH:17][N:16]=4)[CH2:11][CH2:10]3)[N:5]=[C:4]([N:25]3[CH2:30][CH2:29][O:28][CH2:27][CH2:26]3)[N:3]=2)[CH:35]=[CH:36][C:37]=1[F:38]

참가 물질

6

반응물 3

HCID 11430Potassium CarbonateHCID 27346603-Chloro-4-fluorophenylboronic Acid (contains varying amounts of Anhydride)HCID 57761798HCID 57761798, 화합물

생성물 1

HCID 57761071HCID 57761071, 화합물

시약·촉매·용매 2

HCID 178418397HCID 178418397, 화합물촉매HCID 1140Toluene용매

반응 조건

온도
80 °C

실험 절차

A mixture of 4-(4-chloro-5-methyl-6-{4-[3-(trifluoromethyl)(2-pyridyl)]piperazinyl}pyrimidin-2-yl)morpholine (66 mg, 0.15 mmol), 3-chloro-4-fluorophenylboronic acid (35 mg, 0.2 mmol), Pd(PPh3)4 (10 mg) and 2M potassium carbonate (0.2 mL) in toluene (3 mL) is heated, under a nitrogen atmosphere, at 80° C. for 4 hours. The reaction mixture is cooled and the layers separated. The aqueous layer is extracted with EtOAc (3×10 mL) and the combined organics washed with 4M NaOH (10 mL), water (10 mL), brine (10 mL), dried (MgSO4) and concentrated under reduced pressure. The residue is purified by flash chromatography on silica gel (70% hexane/30% ether) to give the title compound. MS 537 (M+1).

후처리

  1. temperatureThe reaction mixture is cooled
  2. customthe layers separated
  3. extractionThe aqueous layer is extracted with EtOAc (3×10 mL)
  4. washthe combined organics washed with 4M NaOH (10 mL), water (10 mL), brine (10 mL)
  5. dry with materialdried (MgSO4)
  6. concentrationconcentrated under reduced pressure
  7. customThe residue is purified by flash chromatography on silica gel (70% hexane/30% ether)

출처 및 근거

ORD 기록
ord-7f80605c1e7549eaa48d67495ca2057b
출처 데이터셋
uspto-grants-2009_07
특허 번호
US07566712B2

반응 노트

불러오는 중…