Dimethylformamide → Tert-butyl 3-chloro-2,4-difluorobenzoate

HRID 240585노트

반응식

HRID 240585 반응식
C([O:5][CH:6]([O:10][C:11]([CH3:14])([CH3:13])[CH3:12])N(C)C)(C)(C)C.[Cl:15][C:16]1[C:17]([F:26])=[C:18]([CH:22]=[CH:23][C:24]=1[F:25])C(O)=O.CN(C=O)C>C([O-])(O)=O.[Na+].CCOC(C)=O>[Cl:15][C:16]1[C:24]([F:25])=[C:23]([CH:22]=[CH:18][C:17]=1[F:26])[C:6]([O:10][C:11]([CH3:12])([CH3:13])[CH3:14])=[O:5]

참가 물질

6

반응물 3

HCID 6228DimethylformamideHCID 5477121,1-bis(1,1-dimethylethoxy)-N,N,N-trimethylamineHCID 27735323-Chloro-2,4-difluorobenzoic acid

생성물 1

HCID 58046346Tert-butyl 3-chloro-2,4-difluorobenzoate

시약·촉매·용매 2

HCID 8857Ethyl Acetate용매HCID 516892Sodium Bicarbonate용매

반응 조건

온도
80 °C

실험 절차

A 125 mL, single-neck, round-bottomed flask was charged with di-tert-butoxy-N,N-dimethylmethanamine (48.2 ml, 201 mmol), 3-chloro-2,4-difluorobenzoic acid (9.67 g, 50.2 mmol), and DMF (50 ml). The reaction was heated to 80° C. for 48 hours. After cooling to ambient temperature, the reaction was diluted with saturated NaHCO3 and EtOAc. The aqueous phase was extracted with EtOAc, and the combined organic phases were washed with saturated NaHCO3 and brine, dried, filtered and concentrated to provide the desired product as a gold oil.

후처리

  1. temperatureAfter cooling to ambient temperature
  2. extractionThe aqueous phase was extracted with EtOAc
  3. washthe combined organic phases were washed with saturated NaHCO3 and brine
  4. customdried
  5. filtrationfiltered
  6. concentrationconcentrated

출처 및 근거

ORD 기록
ord-fa4412622b96455780588c4a1f85a6ca
출처 데이터셋
uspto-grants-2014_02
특허 번호
US08648087B2

반응 노트

불러오는 중…