Glycidyl n-octyl ether → 2-[2-Hydroxy-4-(3-n-octyloxy-2-hydroxypropoxy)phenyl]-2H-benzotriazole

HRID 2413321노트

반응식

HRID 2413321 반응식
[OH:1][C:2]1[CH:7]=[C:6]([OH:8])[CH:5]=[CH:4][C:3]=1[N:9]1[N:13]=[C:12]2[CH:14]=[CH:15][CH:16]=[CH:17][C:11]2=[N:10]1.[CH2:18]([O:26][CH2:27][CH:28]1[O:30][CH2:29]1)[CH2:19][CH2:20][CH2:21][CH2:22][CH2:23][CH2:24][CH3:25]>[Br-].C([P+](C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1)C.CN1CCCC1=O>[OH:1][C:2]1[CH:7]=[C:6]([O:8][CH2:29][CH:28]([OH:30])[CH2:27][O:26][CH2:18][CH2:19][CH2:20][CH2:21][CH2:22][CH2:23][CH2:24][CH3:25])[CH:5]=[CH:4][C:3]=1[N:9]1[N:13]=[C:12]2[CH:14]=[CH:15][CH:16]=[CH:17][C:11]2=[N:10]1

참가 물질

5

반응물 2

HCID 92955Glycidyl n-octyl etherHCID 110641672-(2,4-dihydroxyphenyl)-2H-benzotriazole

생성물 1

HCID 202305442-[2-Hydroxy-4-(3-n-octyloxy-2-hydroxypropoxy)phenyl]-2H-benzotriazole

시약·촉매·용매 2

HCID 73727Phosphonium, ethyltriphenyl-, bromide (1:1)촉매HCID 13387N-methyl-2-pyrrolidone용매

실험 절차

A mixture of 2-(2,4-dihydroxyphenyl)-2H-benzotriazole (7.0 grams, 0.031 mole), 3-n-octyloxy-1,2-epoxypropane (10.7 grams, 0.046 moles), N-methyl-2-pyrrolidone (40 ml) and ethyltriphenylphosphonium bromide (0.2 gram) was heated for four hours at 135°-150° C. The solvent and excess epoxide were then removed by distillation. The resulting residue was dissolved in methylene chloride, washed with hydrochloric acid, water and sodium chloride solution before passing through a silica gel column. The product was obtained as a yellow oil which crystallized on standing. Recrystallization from heptane gave the above named product with a melting point of 51°-55° C.

후처리

  1. temperaturewas heated for four hours at 135°-150° C
  2. customThe solvent and excess epoxide were then removed by distillation
  3. dissolutionThe resulting residue was dissolved in methylene chloride
  4. washwashed with hydrochloric acid, water and sodium chloride solution
  5. customThe product was obtained as a yellow oil which
  6. customcrystallized
  7. customRecrystallization from heptane
  8. customgave the

출처 및 근거

ORD 기록
ord-a55c422699424766b4a6513f33beaa29
출처 데이터셋
uspto-grants-1985_01
특허 번호
US04496676

반응 노트

불러오는 중…