3-Amino-1-propanol → 1-(2-Chloro-5-nitrophenyl)-3-(3-hydroxypropyl)thiourea

HRID 2417910

반응식

HRID 2417910 반응식
[Cl:1][C:2]1[CH:7]=[CH:6][C:5]([N+:8]([O-:10])=[O:9])=[CH:4][C:3]=1[N:11]=[C:12]=[S:13].[NH2:14][CH2:15][CH2:16][CH2:17][OH:18]>C(O)C>[Cl:1][C:2]1[CH:7]=[CH:6][C:5]([N+:8]([O-:10])=[O:9])=[CH:4][C:3]=1[NH:11][C:12]([NH:14][CH2:15][CH2:16][CH2:17][OH:18])=[S:13]

참가 물질

4

반응물 2

HCID 90863-Amino-1-propanolHCID 926811-Chloro-2-isothiocyanato-4-nitrobenzene

생성물 1

HCID 30187341-(2-Chloro-5-nitrophenyl)-3-(3-hydroxypropyl)thiourea수율 72%

시약·촉매·용매 1

HCID 702Ethanol용매

실험 절차

To a stirred solution of 24 parts of 1-chloro-2-isothiocyanato-4-nitrobenzene in 200 parts of ethanol 95% are added dropwise 9 parts of 3-amino-1-propanol at a temperature below 20° C. Upon completion, stirring is continued for 30 minutes at room temperature. The reaction mixture is evaporated. The residue is crystallized from acetonitrile. The product is filtered off and dried, yielding 23 parts (72%) of N-(2-chloro-5-nitrophenyl)-N'-(3-hydroxypropyl)thiourea; mp. 126.8° C.

후처리

  1. customThe reaction mixture is evaporated
  2. customThe residue is crystallized from acetonitrile
  3. filtrationThe product is filtered off
  4. customdried

출처 및 근거

ORD 기록
ord-b508b8a7443b4001aa8c6558af803e13
출처 데이터셋
uspto-grants-1984_09
특허 번호
US04471117

연결된 노트

불러오는 중…