Phenylacetaldehyde → 3-(1,3-Benzodithiol-2-ylideneamino)-5-(2-phenylethylidene)-2-thioxo-4-thiazolidinone

HRID 2419144노트

반응식

HRID 2419144 반응식
[S:1]1[C:5]2[CH:6]=[CH:7][CH:8]=[CH:9][C:4]=2[S:3][C:2]1=[N:10][N:11]1[C:15](=[O:16])[CH2:14][S:13][C:12]1=[S:17].[C:18]1([CH2:24][CH:25]=O)[CH:23]=[CH:22][CH:21]=[CH:20][CH:19]=1>C(O)(=O)C.N1CCCCC1.C(COC)OC>[S:1]1[C:5]2[CH:6]=[CH:7][CH:8]=[CH:9][C:4]=2[S:3][C:2]1=[N:10][N:11]1[C:15](=[O:16])[C:14](=[CH:25][CH2:24][C:18]2[CH:23]=[CH:22][CH:21]=[CH:20][CH:19]=2)[S:13][C:12]1=[S:17]

참가 물질

5

반응물 2

HCID 998PhenylacetaldehydeHCID 124949933-[(1,3-Benzodithiol-2-ylidene)amino]-2-thioxo-4-thiazolidinone

생성물 1

HCID 739981023-(1,3-Benzodithiol-2-ylideneamino)-5-(2-phenylethylidene)-2-thioxo-4-thiazolidinone

시약·촉매·용매 2

HCID 9793820Piperidine, acetate촉매HCID 80711,2-Dimethoxyethane용매

실험 절차

A slurry of 2.98 g of 3-[(1,3-benzodithiol-2-ylidene)amino]-2-thioxo-4-thiazolidinone (see example 37), phenylacetaldehyde (10 ml, excess) and acetic acid/piperidine (10 drops) in 600 ml of anhydrous glyme is heated at reflux for four days. The reaction mixture is filtered while hot, and the solid is collected and recrystallized from dimethylformamide to yield 1.78 g of the title compound, melting point 233°-234° C.

후처리

  1. temperatureat reflux for four days
  2. filtrationThe reaction mixture is filtered while hot, and the solid
  3. customis collected
  4. customrecrystallized from dimethylformamide

출처 및 근거

ORD 기록
ord-feda2da6920f41aeb1a15ecdf46c5539
출처 데이터셋
uspto-grants-1978_08
특허 번호
US04104467

반응 노트

불러오는 중…