Phenylacetaldehyde → 3-(1,3-Benzodithiol-2-ylideneamino)-5-(2-phenylethylidene)-2-thioxo-4-thiazolidinone

HRID 2419569노트

반응식

HRID 2419569 반응식
[S:1]1[C:5]2[CH:6]=[CH:7][CH:8]=[CH:9][C:4]=2[S:3][C:2]1=[N:10][N:11]1[C:15](=[O:16])[CH2:14][S:13][C:12]1=[S:17].[C:18]1([CH2:24][CH:25]=O)[CH:23]=[CH:22][CH:21]=[CH:20][CH:19]=1>C(O)(=O)C.N1CCCCC1.C(COC)OC>[S:1]1[C:5]2[CH:6]=[CH:7][CH:8]=[CH:9][C:4]=2[S:3][C:2]1=[N:10][N:11]1[C:15](=[O:16])[C:14](=[CH:25][CH2:24][C:18]2[CH:23]=[CH:22][CH:21]=[CH:20][CH:19]=2)[S:13][C:12]1=[S:17]

참가 물질

5

반응물 2

HCID 998PhenylacetaldehydeHCID 124949933-[(1,3-Benzodithiol-2-ylidene)amino]-2-thioxo-4-thiazolidinone

생성물 1

HCID 739981023-(1,3-Benzodithiol-2-ylideneamino)-5-(2-phenylethylidene)-2-thioxo-4-thiazolidinone

시약·촉매·용매 2

HCID 9793820Piperidine, acetate촉매HCID 80711,2-Dimethoxyethane용매

실험 절차

A slurry of 2.98g of 3-[(1,3-benzodithiol-2-ylidene)amino] -2-thioxo-4-thiazolidinone (see example 37), phenylacetaldehyde (10 ml, excess) and acetic acid/piperidine (10 drops) in 600 ml of anhydrous glyme is heated at reflux for 4 days. The reaction mixture is filtered while hot, and the solid is collected and recrystallized from dimethylformamide to yield 1.78 g of the title compound, melting point 233°-234° C.

후처리

  1. temperatureat reflux for 4 days
  2. filtrationThe reaction mixture is filtered while hot, and the solid
  3. customis collected
  4. customrecrystallized from dimethylformamide

출처 및 근거

ORD 기록
ord-a77cef40f68a487f8dfcc0e2bee35980
출처 데이터셋
uspto-grants-1978_08
특허 번호
US04107175

반응 노트

불러오는 중…